N-[3,5-dihydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptacos-9-en-2-yl]pentadecanamide
Internal ID | 7c46007e-ebe1-4db5-8e20-02ba6b2a33ca |
Taxonomy | Lipids and lipid-like molecules > Sphingolipids > Glycosphingolipids |
IUPAC Name | N-[3,5-dihydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptacos-9-en-2-yl]pentadecanamide |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCC=CCCCC(CC(C(COC1C(C(C(C(O1)CO)O)O)O)NC(=O)CCCCCCCCCCCCCC)O)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCC=CCCCC(CC(C(COC1C(C(C(C(O1)CO)O)O)O)NC(=O)CCCCCCCCCCCCCC)O)O |
InChI | InChI=1S/C48H93NO9/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-27-29-31-33-35-40(51)37-42(52)41(39-57-48-47(56)46(55)45(54)43(38-50)58-48)49-44(53)36-34-32-30-28-26-16-14-12-10-8-6-4-2/h27,29,40-43,45-48,50-52,54-56H,3-26,28,30-39H2,1-2H3,(H,49,53) |
InChI Key | DUTIXEQGYGUIKI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H93NO9 |
Molecular Weight | 828.30 g/mol |
Exact Mass | 827.68503354 g/mol |
Topological Polar Surface Area (TPSA) | 169.00 Ų |
XlogP | 13.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.48% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 99.13% | 98.95% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 98.46% | 89.63% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.61% | 91.11% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.14% | 97.29% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 95.55% | 92.86% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.52% | 96.09% |
CHEMBL220 | P22303 | Acetylcholinesterase | 95.51% | 94.45% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 94.16% | 92.50% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 94.14% | 96.47% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.52% | 93.56% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.72% | 92.08% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.36% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.57% | 96.00% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 88.19% | 85.94% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.94% | 100.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.30% | 91.24% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.07% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.15% | 94.33% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 85.87% | 91.81% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 85.86% | 95.71% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 85.73% | 95.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.90% | 96.90% |
CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 84.65% | 95.93% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.42% | 82.50% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 84.25% | 92.32% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.19% | 90.17% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 83.36% | 96.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.05% | 95.50% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.66% | 83.82% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.12% | 95.89% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.67% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.66% | 89.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.42% | 98.75% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.61% | 100.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.54% | 92.88% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.13% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erigeron canadensis |
PubChem | 85377070 |
LOTUS | LTS0211646 |
wikiData | Q104989407 |