[(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] (E)-2-methylbut-2-enoate
Internal ID | 30a3d0a4-584d-4f6a-b3ef-5f375e19a3b6 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] (E)-2-methylbut-2-enoate |
SMILES (Canonical) | CC=C(C)C(=O)OC1CC2C3(CCC(CC3=CCC2(C4(C1(C(CC4)(C(=O)C)O)C)O)O)OC5CC(C(C(O5)C)OC6CC(C(C(O6)C)OC7CC(C(C(O7)C)OC8C(C(C(C(O8)C)O)OC)O)OC)OC)OC)C |
SMILES (Isomeric) | C/C=C(\C)/C(=O)O[C@@H]1C[C@@H]2[C@]3(CC[C@@H](CC3=CC[C@]2([C@@]4([C@]1([C@@](CC4)(C(=O)C)O)C)O)O)O[C@H]5C[C@@H]([C@@H]([C@H](O5)C)O[C@H]6C[C@@H]([C@@H]([C@H](O6)C)O[C@H]7C[C@@H]([C@@H]([C@H](O7)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)C)O)OC)O)OC)OC)OC)C |
InChI | InChI=1S/C54H86O20/c1-14-26(2)48(58)71-38-25-37-50(8)17-16-33(21-32(50)15-18-53(37,60)54(61)20-19-52(59,31(7)55)51(38,54)9)70-39-22-34(62-10)44(28(4)66-39)72-40-23-35(63-11)45(29(5)67-40)73-41-24-36(64-12)46(30(6)68-41)74-49-43(57)47(65-13)42(56)27(3)69-49/h14-15,27-30,33-47,49,56-57,59-61H,16-25H2,1-13H3/b26-14+/t27-,28-,29-,30-,33+,34+,35+,36+,37-,38-,39+,40+,41+,42-,43-,44-,45-,46-,47+,49+,50+,51-,52-,53+,54-/m1/s1 |
InChI Key | KIHAALAJJHCBAB-XXHGSSAGSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C54H86O20 |
Molecular Weight | 1055.20 g/mol |
Exact Mass | 1054.57124513 g/mol |
Topological Polar Surface Area (TPSA) | 255.00 Ų |
XlogP | 2.10 |
There are no found synonyms. |
![2D Structure of [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] (E)-2-methylbut-2-enoate 2D Structure of [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,3R,4S,5R,6R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] (E)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/c81d0490-8578-11ee-beb5-4f93bb9d457b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.59% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.18% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.56% | 89.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 93.14% | 92.94% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.87% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.66% | 86.33% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.14% | 91.07% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.38% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 86.46% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.22% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.21% | 95.93% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 85.20% | 98.59% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.10% | 94.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.79% | 91.19% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.31% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.27% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.14% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.92% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.89% | 99.23% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.64% | 97.53% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.34% | 97.25% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.02% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.65% | 96.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.33% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Araujia sericifera |
PubChem | 10953210 |
LOTUS | LTS0223509 |
wikiData | Q105141515 |