8,19-Dihydroxy-7,20-bis(hydroxymethyl)-1,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one
Internal ID | 1d5c6280-c74c-45fc-bbf5-7353c1eb8a9a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 8,19-dihydroxy-7,20-bis(hydroxymethyl)-1,7,11,16,20-pentamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3-en-5-one |
SMILES (Canonical) | CC12CCC3C(C1CCC4C(=CC(=O)C5C4(CCC(C5(C)CO)O)C)C2)(CCC(C3(C)CO)O)C |
SMILES (Isomeric) | CC12CCC3C(C1CCC4C(=CC(=O)C5C4(CCC(C5(C)CO)O)C)C2)(CCC(C3(C)CO)O)C |
InChI | InChI=1S/C30H48O5/c1-26-11-8-22-28(3,13-10-23(34)29(22,4)16-31)21(26)7-6-19-18(15-26)14-20(33)25-27(19,2)12-9-24(35)30(25,5)17-32/h14,19,21-25,31-32,34-35H,6-13,15-17H2,1-5H3 |
InChI Key | BBVAQCLKJCAZLE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O5 |
Molecular Weight | 488.70 g/mol |
Exact Mass | 488.35017463 g/mol |
Topological Polar Surface Area (TPSA) | 98.00 Ų |
XlogP | 5.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.55% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.71% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.44% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.45% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.82% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.14% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 84.21% | 98.95% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.16% | 96.38% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.05% | 82.69% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.65% | 85.30% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.48% | 96.43% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.48% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.23% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.79% | 95.56% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.57% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lycopodiella cernua |
PubChem | 75079488 |
LOTUS | LTS0211761 |
wikiData | Q104923082 |