[(1R,2S,3R,5S,8S,9S,10S,11R,12R,15R)-3-acetyloxy-9,10,15-trihydroxy-12-methyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate
Internal ID | 24128348-7f80-40ad-94ad-23a113e1f938 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | [(1R,2S,3R,5S,8S,9S,10S,11R,12R,15R)-3-acetyloxy-9,10,15-trihydroxy-12-methyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-12-yl]methyl acetate |
SMILES (Canonical) | CC(=O)OCC1(CCC(C23C1C(C(C45C2C(CC(C4)C(=C)C5=O)OC(=O)C)(OC3)O)O)O)C |
SMILES (Isomeric) | CC(=O)OC[C@@]1(CC[C@H]([C@]23[C@@H]1[C@@H]([C@]([C@]45[C@H]2[C@@H](C[C@H](C4)C(=C)C5=O)OC(=O)C)(OC3)O)O)O)C |
InChI | InChI=1S/C24H32O9/c1-11-14-7-15(33-13(3)26)17-22-10-32-24(30,23(17,8-14)19(11)28)20(29)18(22)21(4,6-5-16(22)27)9-31-12(2)25/h14-18,20,27,29-30H,1,5-10H2,2-4H3/t14-,15-,16-,17+,18-,20+,21+,22+,23+,24-/m1/s1 |
InChI Key | LEVRALBKFMUOBN-FEQWJSIDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H32O9 |
Molecular Weight | 464.50 g/mol |
Exact Mass | 464.20463259 g/mol |
Topological Polar Surface Area (TPSA) | 140.00 Ų |
XlogP | -0.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.91% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.96% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.71% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.73% | 90.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.72% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.82% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.27% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.99% | 94.75% |
CHEMBL2581 | P07339 | Cathepsin D | 88.78% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.11% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.23% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.47% | 99.23% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 84.46% | 95.38% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.29% | 97.28% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 83.78% | 96.38% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.18% | 91.07% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 82.28% | 95.93% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.08% | 82.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.03% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.48% | 91.19% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.90% | 90.08% |
CHEMBL5028 | O14672 | ADAM10 | 80.79% | 97.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.22% | 96.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.07% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon enanderianus |
PubChem | 102317170 |
LOTUS | LTS0138302 |
wikiData | Q105150819 |