(2R,3R,4R,5R,6S)-2-[(E)-5-[(1S,4S,4aR,5R,8aR)-4-hydroxy-5,8a-dimethyl-2-methylidene-5-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enoxy]-6-methyloxane-3,4,5-triol
Internal ID | 5d58bdeb-c295-4b16-ae45-21c81b764d84 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Diterpene glycosides |
IUPAC Name | (2R,3R,4R,5R,6S)-2-[(E)-5-[(1S,4S,4aR,5R,8aR)-4-hydroxy-5,8a-dimethyl-2-methylidene-5-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enoxy]-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC=C(C)CCC2C(=C)CC(C3C2(CCCC3(C)COC4C(C(C(C(O4)CO)O)O)O)C)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC/C=C(\C)/CC[C@H]2C(=C)C[C@@H]([C@@H]3[C@@]2(CCC[C@@]3(C)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C)O)O)O)O |
InChI | InChI=1S/C32H54O12/c1-16(9-12-41-29-26(39)24(37)22(35)18(3)43-29)7-8-19-17(2)13-20(34)28-31(4,10-6-11-32(19,28)5)15-42-30-27(40)25(38)23(36)21(14-33)44-30/h9,18-30,33-40H,2,6-8,10-15H2,1,3-5H3/b16-9+/t18-,19-,20-,21+,22-,23+,24+,25-,26+,27+,28-,29+,30+,31-,32+/m0/s1 |
InChI Key | PUHVSLQDLDYLBX-PLNJCKJKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H54O12 |
Molecular Weight | 630.80 g/mol |
Exact Mass | 630.36152715 g/mol |
Topological Polar Surface Area (TPSA) | 199.00 Ų |
XlogP | 0.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.05% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.66% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.61% | 91.49% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.37% | 96.61% |
CHEMBL2581 | P07339 | Cathepsin D | 92.02% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.54% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.12% | 86.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.55% | 95.50% |
CHEMBL233 | P35372 | Mu opioid receptor | 89.53% | 97.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.17% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.24% | 94.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.24% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.84% | 89.00% |
CHEMBL1977 | P11473 | Vitamin D receptor | 87.54% | 99.43% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.26% | 97.36% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.09% | 100.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.80% | 91.24% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.70% | 95.50% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.66% | 95.83% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.44% | 94.73% |
CHEMBL3589 | P55263 | Adenosine kinase | 80.02% | 98.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mitraria coccinea |
PubChem | 15659906 |
LOTUS | LTS0168074 |
wikiData | Q105215102 |