(1R,4Z,6S,7R,11S,12S,17S)-4-ethylidene-7,12-dihydroxy-6,7-dimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadecane-3,8-dione
Internal ID | d54cfdf2-af38-4c68-86b3-226a2d5bb1c9 |
Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
IUPAC Name | (1R,4Z,6S,7R,11S,12S,17S)-4-ethylidene-7,12-dihydroxy-6,7-dimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadecane-3,8-dione |
SMILES (Canonical) | CC=C1CC(C(C(=O)OCC2C(CN3C2C(CC3)OC1=O)O)(C)O)C |
SMILES (Isomeric) | C/C=C\1/C[C@@H]([C@@](C(=O)OC[C@H]2[C@@H](CN3[C@@H]2[C@@H](CC3)OC1=O)O)(C)O)C |
InChI | InChI=1S/C18H27NO6/c1-4-11-7-10(2)18(3,23)17(22)24-9-12-13(20)8-19-6-5-14(15(12)19)25-16(11)21/h4,10,12-15,20,23H,5-9H2,1-3H3/b11-4-/t10-,12-,13+,14+,15-,18+/m0/s1 |
InChI Key | YEXVXKIMPBHRQR-GVPQIDMFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H27NO6 |
Molecular Weight | 353.40 g/mol |
Exact Mass | 353.18383758 g/mol |
Topological Polar Surface Area (TPSA) | 96.30 Ų |
XlogP | 1.00 |
There are no found synonyms. |
![2D Structure of (1R,4Z,6S,7R,11S,12S,17S)-4-ethylidene-7,12-dihydroxy-6,7-dimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadecane-3,8-dione 2D Structure of (1R,4Z,6S,7R,11S,12S,17S)-4-ethylidene-7,12-dihydroxy-6,7-dimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadecane-3,8-dione](https://plantaedb.com/storage/docs/compounds/2023/11/c7bb3dc0-85d6-11ee-a1af-215aa80ba1e5.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL325 | Q13547 | Histone deacetylase 1 | 94.26% | 95.92% |
CHEMBL2581 | P07339 | Cathepsin D | 93.05% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.73% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.40% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.96% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.97% | 99.23% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.56% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.29% | 100.00% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 89.05% | 94.78% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.35% | 91.11% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.33% | 97.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.66% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.75% | 97.09% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.18% | 93.00% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 84.23% | 88.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.06% | 95.89% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.97% | 97.05% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.58% | 90.08% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.11% | 93.03% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.76% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.56% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senecio triangularis |
PubChem | 162898839 |
LOTUS | LTS0218577 |
wikiData | Q105347439 |