methyl (3S)-5-[(1S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]-3-methylpentanoate
Internal ID | 40321a62-b08c-4286-89d0-12d9f8ca0bae |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | methyl (3S)-5-[(1S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]-3-methylpentanoate |
SMILES (Canonical) | CC(CCC1C(=C)C=CC2C1(CCCC2(C)C)C)CC(=O)OC |
SMILES (Isomeric) | C[C@@H](CC[C@H]1C(=C)C=C[C@@H]2[C@@]1(CCCC2(C)C)C)CC(=O)OC |
InChI | InChI=1S/C21H34O2/c1-15(14-19(22)23-6)8-10-17-16(2)9-11-18-20(3,4)12-7-13-21(17,18)5/h9,11,15,17-18H,2,7-8,10,12-14H2,1,3-6H3/t15-,17-,18-,21+/m0/s1 |
InChI Key | QVGBOMRZGFYUNM-QUJKESNLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H34O2 |
Molecular Weight | 318.50 g/mol |
Exact Mass | 318.255880323 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 6.30 |
There are no found synonyms. |
![2D Structure of methyl (3S)-5-[(1S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]-3-methylpentanoate 2D Structure of methyl (3S)-5-[(1S,4aS,8aR)-5,5,8a-trimethyl-2-methylidene-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl]-3-methylpentanoate](https://plantaedb.com/storage/docs/compounds/2023/11/c7661890-861c-11ee-a23a-4f3a70c01de9.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.93% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.86% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.66% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.19% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 89.96% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.56% | 90.17% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.83% | 100.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.70% | 83.82% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.95% | 91.07% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.63% | 94.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.53% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.42% | 95.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.48% | 82.69% |
CHEMBL5028 | O14672 | ADAM10 | 81.44% | 97.50% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.19% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.43% | 97.09% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.35% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cistus symphytifolius |
PubChem | 162924262 |
LOTUS | LTS0087043 |
wikiData | Q105228642 |