[6-[[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] 10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-3-oxo-4,5,6,7,8,8a,10,11,12,14b-decahydro-1H-picene-4a-carboxylate
Internal ID | 9b741b03-6ff7-4c99-9e1c-4df124083cbc |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [6-[[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] 10-hydroxy-2,2,6a,6b,9,9,12a-heptamethyl-3-oxo-4,5,6,7,8,8a,10,11,12,14b-decahydro-1H-picene-4a-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC(=O)C45CCC6(C(=CC=C7C6(CCC8C7(CCC(C8(C)C)O)C)C)C4CC(C(=O)C5)(C)C)C)O)O)O)CO)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC(=O)C45CCC6(C(=CC=C7C6(CCC8C7(CCC(C8(C)C)O)C)C)C4CC(C(=O)C5)(C)C)C)O)O)O)CO)O)O)O |
InChI | InChI=1S/C48H74O18/c1-21-30(52)32(54)35(57)40(62-21)65-38-24(19-49)63-39(37(59)34(38)56)61-20-25-31(53)33(55)36(58)41(64-25)66-42(60)48-16-15-46(7)22(23(48)17-43(2,3)29(51)18-48)9-10-27-45(6)13-12-28(50)44(4,5)26(45)11-14-47(27,46)8/h9-10,21,23-26,28,30-41,49-50,52-59H,11-20H2,1-8H3 |
InChI Key | SQSRUIJOHYWBIM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H74O18 |
Molecular Weight | 939.10 g/mol |
Exact Mass | 938.48751551 g/mol |
Topological Polar Surface Area (TPSA) | 292.00 Ų |
XlogP | -0.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.65% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.61% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.58% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.18% | 96.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.52% | 97.36% |
CHEMBL2581 | P07339 | Cathepsin D | 90.75% | 98.95% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 90.46% | 95.83% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.24% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.63% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.61% | 89.00% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 87.21% | 97.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.46% | 92.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.75% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.23% | 100.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.09% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.09% | 94.45% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.41% | 93.04% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.33% | 97.25% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.48% | 92.94% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.20% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tetrapanax papyrifer |
PubChem | 85203448 |
LOTUS | LTS0185411 |
wikiData | Q105258524 |