(8-acetyloxy-4,9-dihydroxy-5,8a-dimethyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl) 3-methylbutanoate
Internal ID | 87f92fca-7081-481c-bebb-763d5684d6bd |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones |
IUPAC Name | (8-acetyloxy-4,9-dihydroxy-5,8a-dimethyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl) 3-methylbutanoate |
SMILES (Canonical) | CC1C2C(CC(C2(C(C3C(C1O)OC(=O)C3=C)O)C)OC(=O)C)OC(=O)CC(C)C |
SMILES (Isomeric) | CC1C2C(CC(C2(C(C3C(C1O)OC(=O)C3=C)O)C)OC(=O)C)OC(=O)CC(C)C |
InChI | InChI=1S/C22H32O8/c1-9(2)7-15(24)29-13-8-14(28-12(5)23)22(6)17(13)11(4)18(25)19-16(20(22)26)10(3)21(27)30-19/h9,11,13-14,16-20,25-26H,3,7-8H2,1-2,4-6H3 |
InChI Key | JZZXHIGYDDCVDC-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H32O8 |
Molecular Weight | 424.50 g/mol |
Exact Mass | 424.20971797 g/mol |
Topological Polar Surface Area (TPSA) | 119.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.70% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.35% | 85.14% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.27% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.81% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.97% | 94.45% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 93.30% | 97.79% |
CHEMBL2581 | P07339 | Cathepsin D | 89.82% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.44% | 86.33% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.16% | 96.47% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.56% | 89.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.18% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.83% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.34% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.17% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.01% | 97.25% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.55% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.99% | 97.14% |
CHEMBL299 | P17252 | Protein kinase C alpha | 80.77% | 98.03% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.54% | 95.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.01% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gaillardia pulchella |
PubChem | 162884068 |
LOTUS | LTS0205234 |
wikiData | Q105137750 |