[(3S,4S,5S,9R,10R,13R,14R,17R)-17-[(2S,3R,5R)-5-ethyl-3-hydroxy-6-methylheptan-2-yl]-4,10,13-trimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-hydroxybenzoate
Internal ID | 59003198-3b9e-479e-974c-790bd53431b5 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | [(3S,4S,5S,9R,10R,13R,14R,17R)-17-[(2S,3R,5R)-5-ethyl-3-hydroxy-6-methylheptan-2-yl]-4,10,13-trimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-hydroxybenzoate |
SMILES (Canonical) | CCC(CC(C(C)C1CCC2C1(CCC3C2=CC(=O)C4C3(CCC(C4C)OC(=O)C5=CC=C(C=C5)O)C)C)O)C(C)C |
SMILES (Isomeric) | CC[C@H](C[C@H]([C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2=CC(=O)[C@@H]4[C@@]3(CC[C@@H]([C@H]4C)OC(=O)C5=CC=C(C=C5)O)C)C)O)C(C)C |
InChI | InChI=1S/C37H54O5/c1-8-24(21(2)3)19-31(39)22(4)28-13-14-29-27-20-32(40)34-23(5)33(42-35(41)25-9-11-26(38)12-10-25)16-18-37(34,7)30(27)15-17-36(28,29)6/h9-12,20-24,28-31,33-34,38-39H,8,13-19H2,1-7H3/t22-,23+,24+,28+,29-,30-,31+,33-,34+,36+,37+/m0/s1 |
InChI Key | ZWTFLEDANUBHKP-ASLGGNRMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H54O5 |
Molecular Weight | 578.80 g/mol |
Exact Mass | 578.39712482 g/mol |
Topological Polar Surface Area (TPSA) | 83.80 Ų |
XlogP | 9.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.42% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.64% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.43% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.08% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.52% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.73% | 97.25% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 92.55% | 96.38% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.06% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.93% | 95.89% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 91.75% | 85.31% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.98% | 95.89% |
CHEMBL268 | P43235 | Cathepsin K | 88.66% | 96.85% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.21% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.61% | 100.00% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 87.28% | 98.35% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.73% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.37% | 89.00% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.07% | 97.28% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.40% | 97.79% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.08% | 100.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.02% | 90.24% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.84% | 99.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.40% | 91.19% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 82.05% | 94.97% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.89% | 98.75% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 80.59% | 97.53% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 80.49% | 97.64% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.20% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum virginianum |
PubChem | 163032896 |
LOTUS | LTS0145416 |
wikiData | Q105385207 |