methyl (13E)-13-ethylidene-1,11-diazapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2,4,6,8(17)-tetraene-18-carboxylate
Internal ID | f67b812c-e2ec-4568-9d08-eb401204ac27 |
Taxonomy | Alkaloids and derivatives > Pleiocarpaman alkaloids |
IUPAC Name | methyl (13E)-13-ethylidene-1,11-diazapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2,4,6,8(17)-tetraene-18-carboxylate |
SMILES (Canonical) | CC=C1CN2CCC3=C4C2CC1C(N4C5=CC=CC=C35)C(=O)OC |
SMILES (Isomeric) | C/C=C\1/CN2CCC3=C4C2CC1C(N4C5=CC=CC=C35)C(=O)OC |
InChI | InChI=1S/C20H22N2O2/c1-3-12-11-21-9-8-14-13-6-4-5-7-16(13)22-18(14)17(21)10-15(12)19(22)20(23)24-2/h3-7,15,17,19H,8-11H2,1-2H3/b12-3- |
InChI Key | NTMOAQDHNZYZMZ-BASWHVEKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22N2O2 |
Molecular Weight | 322.40 g/mol |
Exact Mass | 322.168127949 g/mol |
Topological Polar Surface Area (TPSA) | 34.50 Ų |
XlogP | 2.50 |
There are no found synonyms. |
![2D Structure of methyl (13E)-13-ethylidene-1,11-diazapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2,4,6,8(17)-tetraene-18-carboxylate 2D Structure of methyl (13E)-13-ethylidene-1,11-diazapentacyclo[12.3.1.02,7.08,17.011,16]octadeca-2,4,6,8(17)-tetraene-18-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/c71263c0-857b-11ee-8ce7-5582b0c88a88.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.04% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.54% | 96.09% |
CHEMBL2535 | P11166 | Glucose transporter | 89.04% | 98.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.78% | 99.23% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.75% | 91.11% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.67% | 95.83% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.12% | 94.45% |
CHEMBL5028 | O14672 | ADAM10 | 84.99% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.51% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.78% | 85.14% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.60% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alstonia angustifolia |
Alstonia rostrata |
Catharanthus roseus |
Hunteria umbellata |
Hunteria zeylanica |
Kopsia fruticosa |
Kopsia teoi |
PubChem | 12314382 |
LOTUS | LTS0191644 |
wikiData | Q105185521 |