(1S,3S,11R,14S)-14-(hydroxymethyl)-3-(1H-indol-3-yl)-19-methyl-15,16,17-trithia-10,12,19-triazapentacyclo[12.3.2.01,12.03,11.04,9]nonadeca-4,6,8-triene-13,18-dione
| Internal ID | 52a92844-4600-4d40-a75e-d052a6e94305 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyrroloindoles |
| IUPAC Name | (1S,3S,11R,14S)-14-(hydroxymethyl)-3-(1H-indol-3-yl)-19-methyl-15,16,17-trithia-10,12,19-triazapentacyclo[12.3.2.01,12.03,11.04,9]nonadeca-4,6,8-triene-13,18-dione |
| SMILES (Canonical) | CN1C(=O)C23CC4(C(N2C(=O)C1(SSS3)CO)NC5=CC=CC=C54)C6=CNC7=CC=CC=C76 |
| SMILES (Isomeric) | CN1C(=O)[C@@]23C[C@]4([C@@H](N2C(=O)[C@@]1(SSS3)CO)NC5=CC=CC=C54)C6=CNC7=CC=CC=C76 |
| InChI | InChI=1S/C23H20N4O3S3/c1-26-19(29)22-11-21(15-10-24-16-8-4-2-6-13(15)16)14-7-3-5-9-17(14)25-18(21)27(22)20(30)23(26,12-28)32-33-31-22/h2-10,18,24-25,28H,11-12H2,1H3/t18-,21-,22+,23+/m1/s1 |
| InChI Key | AKCLRALPZXLOBG-QQUTXWOLSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C23H20N4O3S3 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.06975403 g/mol |
| Topological Polar Surface Area (TPSA) | 165.00 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of (1S,3S,11R,14S)-14-(hydroxymethyl)-3-(1H-indol-3-yl)-19-methyl-15,16,17-trithia-10,12,19-triazapentacyclo[12.3.2.01,12.03,11.04,9]nonadeca-4,6,8-triene-13,18-dione](https://plantaedb.com/storage/docs/compounds/2023/11/c6e11440-841f-11ee-a859-13785c6e5649.jpg "2D Structure of (1S,3S,11R,14S)-14-(hydroxymethyl)-3-(1H-indol-3-yl)-19-methyl-15,16,17-trithia-10,12,19-triazapentacyclo[12.3.2.01,12.03,11.04,9]nonadeca-4,6,8-triene-13,18-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.41% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.74% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.43% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.81% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.52% | 95.56% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 95.33% | 88.56% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 93.90% | 98.59% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 92.36% | 92.97% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.45% | 94.75% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.40% | 90.08% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 89.10% | 94.62% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 88.85% | 96.39% |
| CHEMBL228 | P31645 | Serotonin transporter | 88.75% | 95.51% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.95% | 93.99% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 87.34% | 85.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.09% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.91% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.74% | 97.09% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 84.51% | 95.00% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 84.46% | 80.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.45% | 90.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.76% | 94.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 82.15% | 97.64% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 81.76% | 89.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 71497283 |
| LOTUS | LTS0160934 |
| wikiData | Q77281084 |