17-(7-Hydroxy-5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-3-(3,4,5-trimethoxyoxan-2-yl)oxy-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-4,6,8,15-tetrol
| Internal ID | 820a8639-43a8-4334-8b1a-d4821ffdcaf0 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Ergostane steroids |
| IUPAC Name | 17-(7-hydroxy-5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-3-(3,4,5-trimethoxyoxan-2-yl)oxy-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-4,6,8,15-tetrol |
| SMILES (Canonical) | CC(CO)C(C)C=CC(C)C1CC(C2C1(CCC3C2(CC(C4C3(CCC(C4O)OC5C(C(C(CO5)OC)OC)OC)C)O)O)C)O |
| SMILES (Isomeric) | CC(CO)C(C)C=CC(C)C1CC(C2C1(CCC3C2(CC(C4C3(CCC(C4O)OC5C(C(C(CO5)OC)OC)OC)C)O)O)C)O |
| InChI | InChI=1S/C36H62O10/c1-19(21(3)17-37)9-10-20(2)22-15-23(38)32-34(22,4)14-12-27-35(5)13-11-25(29(40)28(35)24(39)16-36(27,32)41)46-33-31(44-8)30(43-7)26(42-6)18-45-33/h9-10,19-33,37-41H,11-18H2,1-8H3 |
| InChI Key | XCYCRCOUYTYMIM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C36H62O10 |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 654.43429817 g/mol |
| Topological Polar Surface Area (TPSA) | 147.00 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
![2D Structure of 17-(7-Hydroxy-5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-3-(3,4,5-trimethoxyoxan-2-yl)oxy-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-4,6,8,15-tetrol](https://plantaedb.com/storage/docs/compounds/2023/11/c6c10080-822f-11ee-8fa4-cd1527717e0c.jpg "2D Structure of 17-(7-Hydroxy-5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-3-(3,4,5-trimethoxyoxan-2-yl)oxy-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-4,6,8,15-tetrol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL204 | P00734 | Thrombin | 99.37% | 96.01% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.20% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.66% | 91.11% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 97.03% | 95.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.79% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.17% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.37% | 97.09% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.54% | 95.58% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.32% | 94.45% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.27% | 97.14% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.76% | 90.17% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 89.12% | 91.07% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.04% | 95.89% |
| CHEMBL233 | P35372 | Mu opioid receptor | 88.07% | 97.93% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.73% | 92.86% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.52% | 92.98% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.09% | 100.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.49% | 82.69% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.23% | 96.77% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 85.71% | 88.81% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.54% | 95.89% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.39% | 97.33% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.06% | 97.28% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.95% | 92.88% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.11% | 96.47% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.38% | 98.75% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.51% | 98.10% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.77% | 96.21% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 81.56% | 95.36% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.29% | 94.75% |
| CHEMBL3820 | P35557 | Hexokinase type IV | 80.62% | 91.96% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 80.09% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73810060 |
| LOTUS | LTS0198032 |
| wikiData | Q105325541 |