[(2R,3S,4S,5R,6S)-6-[(2S,3R,4R,5R,6S)-2-[4-[(2S,11R)-11-acetyloxy-9-[(2S)-2-methylbutanoyl]-4-oxo-1,5,9-triazacyclotridec-2-yl]phenoxy]-4,5-dihydroxy-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-2-methylbut-2-enoate
Internal ID | 2a3c203c-7d7e-48de-bd8f-c979525d2ba3 |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | [(2R,3S,4S,5R,6S)-6-[(2S,3R,4R,5R,6S)-2-[4-[(2S,11R)-11-acetyloxy-9-[(2S)-2-methylbutanoyl]-4-oxo-1,5,9-triazacyclotridec-2-yl]phenoxy]-4,5-dihydroxy-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-2-methylbut-2-enoate |
SMILES (Canonical) | CCC(C)C(=O)N1CCCNC(=O)CC(NCCC(C1)OC(=O)C)C2=CC=C(C=C2)OC3C(C(C(C(O3)C)O)O)OC4C(C(C(C(O4)COC(=O)C(=CC)C)O)O)O |
SMILES (Isomeric) | CC[C@H](C)C(=O)N1CCCNC(=O)C[C@H](NCC[C@H](C1)OC(=O)C)C2=CC=C(C=C2)O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)/C(=C/C)/C)O)O)O |
InChI | InChI=1S/C40H61N3O15/c1-7-21(3)37(51)43-17-9-15-42-30(45)18-28(41-16-14-27(19-43)55-24(6)44)25-10-12-26(13-11-25)56-40-36(34(49)31(46)23(5)54-40)58-39-35(50)33(48)32(47)29(57-39)20-53-38(52)22(4)8-2/h8,10-13,21,23,27-29,31-36,39-41,46-50H,7,9,14-20H2,1-6H3,(H,42,45)/b22-8+/t21-,23-,27+,28-,29+,31-,32+,33-,34+,35+,36+,39-,40-/m0/s1 |
InChI Key | OTFKFFVPSWCTJU-OGBDHXATSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H61N3O15 |
Molecular Weight | 823.90 g/mol |
Exact Mass | 823.41026825 g/mol |
Topological Polar Surface Area (TPSA) | 252.00 Ų |
XlogP | -0.10 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6S)-6-[(2S,3R,4R,5R,6S)-2-[4-[(2S,11R)-11-acetyloxy-9-[(2S)-2-methylbutanoyl]-4-oxo-1,5,9-triazacyclotridec-2-yl]phenoxy]-4,5-dihydroxy-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-2-methylbut-2-enoate 2D Structure of [(2R,3S,4S,5R,6S)-6-[(2S,3R,4R,5R,6S)-2-[4-[(2S,11R)-11-acetyloxy-9-[(2S)-2-methylbutanoyl]-4-oxo-1,5,9-triazacyclotridec-2-yl]phenoxy]-4,5-dihydroxy-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/c629dd60-8683-11ee-9f21-c55056206560.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.43% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.16% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 98.52% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.22% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.74% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 96.71% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.18% | 97.25% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 95.17% | 83.57% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.01% | 95.93% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 92.29% | 94.80% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.45% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.34% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.37% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.32% | 99.23% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 88.09% | 90.08% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.38% | 94.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.97% | 93.56% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 86.14% | 95.58% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.87% | 98.33% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 85.59% | 96.31% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.40% | 93.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.99% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.92% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.42% | 91.49% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.84% | 94.33% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.74% | 86.00% |
CHEMBL5028 | O14672 | ADAM10 | 80.58% | 97.50% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.53% | 95.83% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.36% | 93.04% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.07% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Meehania urticifolia |
PubChem | 44179263 |
LOTUS | LTS0102728 |
wikiData | Q105199559 |