(2R,3R,4S,5R,6R)-2-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 500b56b7-4092-4fae-8f69-625e6204e1ca |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | (2R,3R,4S,5R,6R)-2-[[(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CCC(C=CC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C)C(C)C |
SMILES (Isomeric) | CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O[C@H]5[C@@H]([C@H]([C@H]([C@H](O5)CO)O)O)O)C)C)C(C)C |
InChI | InChI=1S/C35H58O6/c1-7-22(20(2)3)9-8-21(4)26-12-13-27-25-11-10-23-18-24(14-16-34(23,5)28(25)15-17-35(26,27)6)40-33-32(39)31(38)30(37)29(19-36)41-33/h8-10,20-22,24-33,36-39H,7,11-19H2,1-6H3/b9-8+/t21-,22-,24+,25+,26-,27+,28+,29-,30+,31+,32-,33-,34+,35-/m1/s1 |
InChI Key | VWDLOXMZIGUBKM-GLQXZYKNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H58O6 |
Molecular Weight | 574.80 g/mol |
Exact Mass | 574.42333957 g/mol |
Topological Polar Surface Area (TPSA) | 99.40 Ų |
XlogP | 7.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.57% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.26% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.68% | 95.93% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.51% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.66% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 95.26% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.89% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.54% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.19% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.35% | 93.56% |
CHEMBL237 | P41145 | Kappa opioid receptor | 88.71% | 98.10% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.90% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.84% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.76% | 89.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.37% | 96.21% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.17% | 92.86% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.46% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.21% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.42% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rhynchosia minima |
PubChem | 162928678 |
LOTUS | LTS0070964 |
wikiData | Q105298023 |