(1S,2R,4S,5R,8R,10S,13S,14R,17S,18R,22S,23S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5,9,9,14,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosane-2,22,23-triol
Internal ID | 05aab58f-0a3c-46e5-b30b-8d7830282558 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,2R,4S,5R,8R,10S,13S,14R,17S,18R,22S,23S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5,9,9,14,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosane-2,22,23-triol |
SMILES (Canonical) | CC1(CC2C34CCC5(C6CCC(C(C6CCC5(C3(CC(C2(C(C1)O)C(O4)O)O)C)C)(C)C)OC7C(C(C(CO7)OC8C(C(C(C(O8)CO)O)O)OC9C(C(C(CO9)O)O)O)O)OC1C(C(C(C(O1)CO)O)O)O)C)C |
SMILES (Isomeric) | C[C@]12CC[C@]34[C@@H]5CC(C[C@@H]([C@@]5([C@@H](C[C@]3([C@@]1(CC[C@@H]6[C@@H]2CC[C@@H](C6(C)C)O[C@H]7[C@@H]([C@H]([C@H](CO7)O[C@H]8[C@@H]([C@H]([C@H]([C@H](O8)CO)O)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O)C)C)O)[C@H](O4)O)O)(C)C |
InChI | InChI=1S/C52H86O23/c1-46(2)14-27-51-13-12-48(5)22-8-9-30(47(3,4)21(22)10-11-49(48,6)50(51,7)16-29(57)52(27,28(56)15-46)45(66)75-51)72-43-39(74-42-38(65)35(62)32(59)24(17-53)69-42)34(61)26(20-68-43)71-44-40(36(63)33(60)25(18-54)70-44)73-41-37(64)31(58)23(55)19-67-41/h21-45,53-66H,8-20H2,1-7H3/t21-,22+,23-,24-,25-,26+,27+,28+,29-,30+,31+,32+,33+,34+,35+,36+,37-,38-,39-,40-,41+,42+,43+,44+,45+,48-,49-,50+,51+,52+/m1/s1 |
InChI Key | IFQXAVBYISKPEF-OVZMVBCUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C52H86O23 |
Molecular Weight | 1079.20 g/mol |
Exact Mass | 1078.55598899 g/mol |
Topological Polar Surface Area (TPSA) | 366.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
![2D Structure of (1S,2R,4S,5R,8R,10S,13S,14R,17S,18R,22S,23S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5,9,9,14,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosane-2,22,23-triol 2D Structure of (1S,2R,4S,5R,8R,10S,13S,14R,17S,18R,22S,23S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5,9,9,14,20,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosane-2,22,23-triol](https://plantaedb.com/storage/docs/compounds/2023/11/c612ff00-8730-11ee-85f5-8d51a78982ef.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.30% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 95.06% | 96.61% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.75% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.56% | 95.93% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.40% | 97.36% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 90.69% | 95.38% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 90.48% | 91.03% |
CHEMBL1871 | P10275 | Androgen Receptor | 90.31% | 96.43% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.31% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.23% | 90.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.18% | 100.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 90.04% | 96.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.74% | 95.89% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 87.58% | 97.33% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 87.38% | 92.98% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 87.16% | 97.53% |
CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 86.41% | 94.05% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.18% | 97.79% |
CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 | 86.05% | 95.52% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.94% | 92.86% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 85.90% | 98.99% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.84% | 95.50% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 84.82% | 97.86% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 84.56% | 92.78% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.41% | 95.83% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.35% | 92.88% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.93% | 91.24% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.45% | 91.07% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.38% | 97.25% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.13% | 92.94% |
CHEMBL233 | P35372 | Mu opioid receptor | 82.76% | 97.93% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.66% | 94.33% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 82.52% | 95.36% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 81.84% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.40% | 94.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.25% | 97.14% |
CHEMBL3589 | P55263 | Adenosine kinase | 80.66% | 98.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lysimachia capillipes |
PubChem | 162821246 |
LOTUS | LTS0191245 |
wikiData | Q105112318 |