[(1R,8R,9S,18R,19R,21S,22S)-7,7,8,12,13-pentahydroxy-3,6,16-trioxo-21,22-bis[(3,4,5-trihydroxybenzoyl)oxy]-2,17,20,23-tetraoxapentacyclo[16.3.1.18,11.04,9.010,15]tricosa-4,10,12,14-tetraen-19-yl]methyl 3,4,5-trihydroxybenzoate
Internal ID | 4bb04004-431e-4475-9630-57e9e77d8197 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(1R,8R,9S,18R,19R,21S,22S)-7,7,8,12,13-pentahydroxy-3,6,16-trioxo-21,22-bis[(3,4,5-trihydroxybenzoyl)oxy]-2,17,20,23-tetraoxapentacyclo[16.3.1.18,11.04,9.010,15]tricosa-4,10,12,14-tetraen-19-yl]methyl 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=O)C(C6(C5C7=C(O6)C(=C(C=C7C(=O)O3)O)O)O)(O)O)OC(=O)C8=CC(=C(C(=C8)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)OC[C@@H]2[C@@H]3[C@@H]([C@H]([C@@H](O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=O)C([C@]6([C@H]5C7=C(O6)C(=C(C=C7C(=O)O3)O)O)O)(O)O)OC(=O)C8=CC(=C(C(=C8)O)O)O |
InChI | InChI=1S/C41H30O27/c42-15-1-10(2-16(43)26(15)50)34(54)62-9-22-30-32(65-35(55)11-3-17(44)27(51)18(45)4-11)33(39(63-22)67-36(56)12-5-19(46)28(52)20(47)6-12)66-38(58)14-8-23(49)40(59,60)41(61)25(14)24-13(37(57)64-30)7-21(48)29(53)31(24)68-41/h1-8,22,25,30,32-33,39,42-48,50-53,59-61H,9H2/t22-,25-,30-,32+,33-,39+,41-/m1/s1 |
InChI Key | BTIDLTNVHZCDPS-KUZSCSPXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H30O27 |
Molecular Weight | 954.70 g/mol |
Exact Mass | 954.09744568 g/mol |
Topological Polar Surface Area (TPSA) | 450.00 Ų |
XlogP | -0.30 |
There are no found synonyms. |
![2D Structure of [(1R,8R,9S,18R,19R,21S,22S)-7,7,8,12,13-pentahydroxy-3,6,16-trioxo-21,22-bis[(3,4,5-trihydroxybenzoyl)oxy]-2,17,20,23-tetraoxapentacyclo[16.3.1.18,11.04,9.010,15]tricosa-4,10,12,14-tetraen-19-yl]methyl 3,4,5-trihydroxybenzoate 2D Structure of [(1R,8R,9S,18R,19R,21S,22S)-7,7,8,12,13-pentahydroxy-3,6,16-trioxo-21,22-bis[(3,4,5-trihydroxybenzoyl)oxy]-2,17,20,23-tetraoxapentacyclo[16.3.1.18,11.04,9.010,15]tricosa-4,10,12,14-tetraen-19-yl]methyl 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/c602bf00-84f9-11ee-8da2-47b21c453f71.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.45% | 91.49% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 96.29% | 83.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.02% | 95.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.74% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.08% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.01% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.80% | 89.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.31% | 92.50% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 86.04% | 95.64% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.49% | 96.09% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 83.86% | 94.42% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.37% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.18% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.54% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.93% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.59% | 95.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.33% | 91.19% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.32% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euphorbia maculata |
PubChem | 101597198 |
LOTUS | LTS0081235 |
wikiData | Q104945641 |