(1R,2R)-1-(4-hydroxy-3-methoxyphenyl)-2-[4-[[(3R,4R,5S)-5-(4-hydroxy-3-methoxyphenyl)-4-(hydroxymethyl)oxolan-3-yl]methyl]-2-methoxyphenoxy]propane-1,3-diol
Internal ID | b7d09973-7d02-4c42-9834-6dbdf0f51bc1 |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans > Tetrahydrofuran lignans > 7,9-epoxylignans |
IUPAC Name | (1R,2R)-1-(4-hydroxy-3-methoxyphenyl)-2-[4-[[(3R,4R,5S)-5-(4-hydroxy-3-methoxyphenyl)-4-(hydroxymethyl)oxolan-3-yl]methyl]-2-methoxyphenoxy]propane-1,3-diol |
SMILES (Canonical) | COC1=C(C=CC(=C1)CC2COC(C2CO)C3=CC(=C(C=C3)O)OC)OC(CO)C(C4=CC(=C(C=C4)O)OC)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C[C@H]2CO[C@@H]([C@H]2CO)C3=CC(=C(C=C3)O)OC)O[C@H](CO)[C@@H](C4=CC(=C(C=C4)O)OC)O |
InChI | InChI=1S/C30H36O10/c1-36-25-12-18(5-7-22(25)33)29(35)28(15-32)40-24-9-4-17(11-27(24)38-3)10-20-16-39-30(21(20)14-31)19-6-8-23(34)26(13-19)37-2/h4-9,11-13,20-21,28-35H,10,14-16H2,1-3H3/t20-,21-,28+,29+,30+/m0/s1 |
InChI Key | HWOVOVPIJPKUFP-JMSSLMJNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H36O10 |
Molecular Weight | 556.60 g/mol |
Exact Mass | 556.23084734 g/mol |
Topological Polar Surface Area (TPSA) | 147.00 Ų |
XlogP | 2.60 |
There are no found synonyms. |
![2D Structure of (1R,2R)-1-(4-hydroxy-3-methoxyphenyl)-2-[4-[[(3R,4R,5S)-5-(4-hydroxy-3-methoxyphenyl)-4-(hydroxymethyl)oxolan-3-yl]methyl]-2-methoxyphenoxy]propane-1,3-diol 2D Structure of (1R,2R)-1-(4-hydroxy-3-methoxyphenyl)-2-[4-[[(3R,4R,5S)-5-(4-hydroxy-3-methoxyphenyl)-4-(hydroxymethyl)oxolan-3-yl]methyl]-2-methoxyphenoxy]propane-1,3-diol](https://plantaedb.com/storage/docs/compounds/2023/11/c5f15050-84c1-11ee-b97c-c729b005dc94.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.22% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.76% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 97.08% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.90% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.98% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.08% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.60% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.09% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.80% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.37% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.81% | 92.62% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 87.78% | 85.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.48% | 89.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.13% | 86.92% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.87% | 97.14% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.68% | 89.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.87% | 95.89% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 84.60% | 97.50% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.31% | 100.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.09% | 99.15% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 81.39% | 97.31% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.37% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 81.03% | 98.75% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.01% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ehretia matthewii |
PubChem | 162891500 |
LOTUS | LTS0184505 |
wikiData | Q105034756 |