5-Hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one
Internal ID | 0e987c6a-2d7c-4c61-a791-b28ea537f72d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)OC4C(C(C(C(O4)CO)O)O)O)C5=CC(=C(C(=C5)OC)O)OC)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)OC4C(C(C(C(O4)CO)O)O)O)C5=CC(=C(C(=C5)OC)O)OC)O)O)O |
InChI | InChI=1S/C29H34O17/c1-9-18(32)22(36)24(38)28(42-9)46-27-21(35)17-12(31)6-11(43-29-25(39)23(37)20(34)16(8-30)45-29)7-13(17)44-26(27)10-4-14(40-2)19(33)15(5-10)41-3/h4-7,9,16,18,20,22-25,28-34,36-39H,8H2,1-3H3 |
InChI Key | YVVOJXOBWWQZIB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H34O17 |
Molecular Weight | 654.60 g/mol |
Exact Mass | 654.17959961 g/mol |
Topological Polar Surface Area (TPSA) | 264.00 Ų |
XlogP | -0.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.43% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.57% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.06% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.97% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.60% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.79% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.52% | 86.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.28% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.58% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.39% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.26% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.75% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.60% | 91.49% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.79% | 86.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.52% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.86% | 96.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.83% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.53% | 96.21% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.89% | 95.64% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.63% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.49% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 80.49% | 90.71% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.11% | 94.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Embelia keniensis |
PubChem | 162916810 |
LOTUS | LTS0112402 |
wikiData | Q105366066 |