[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-[4-hydroxy-5-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxyphenyl]-5-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-7-yl]oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 8bb7e6ff-3a3b-46b6-ab58-be13946022cf |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid 3p-O-p-coumaroyl glycosides |
IUPAC Name | [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-[4-hydroxy-5-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxyphenyl]-5-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-7-yl]oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=CC(=O)C4=CC(=C(OC4=C3)C5=CC(=C(C(=C5)OC6C(C(C(C(O6)COC(=O)C=CC7=CC=C(C=C7)O)O)O)O)O)OC8C(C(C(C(O8)COC(=O)C=CC9=CC=C(C=C9)O)O)O)O)OC1C(C(C(C(O1)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C=CC(=O)OC[C@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=O)C4=CC(=C(OC4=C3)C5=CC(=C(C(=C5)O[C@H]6[C@H]([C@@H]([C@@H]([C@H](O6)COC(=O)C=CC7=CC=C(C=C7)O)O)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)COC(=O)C=CC9=CC=C(C=C9)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C66H68O33/c67-24-42-50(76)54(80)59(85)66(96-42)95-41-23-36-37(71)21-35(91-63-58(84)55(81)51(77)43(97-63)25-88-46(72)16-7-28-1-10-32(68)11-2-28)22-38(36)92-62(41)31-19-39(93-64-60(86)56(82)52(78)44(98-64)26-89-47(73)17-8-29-3-12-33(69)13-4-29)49(75)40(20-31)94-65-61(87)57(83)53(79)45(99-65)27-90-48(74)18-9-30-5-14-34(70)15-6-30/h1-23,42-45,50-61,63-70,75-87H,24-27H2/t42-,43+,44-,45-,50-,51-,52-,53-,54+,55+,56-,57+,58-,59-,60+,61-,63-,64-,65-,66-/m1/s1 |
InChI Key | ACDFZTTZFFZFFC-BBDCKABLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C66H68O33 |
Molecular Weight | 1389.20 g/mol |
Exact Mass | 1388.3642846 g/mol |
Topological Polar Surface Area (TPSA) | 523.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
![2D Structure of [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-[4-hydroxy-5-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxyphenyl]-5-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-7-yl]oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-[4-hydroxy-5-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]oxan-2-yl]oxyphenyl]-5-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-7-yl]oxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/c5974280-84ac-11ee-9ede-cdbd3e8b659d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.90% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.58% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.44% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 94.79% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.72% | 91.49% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.29% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 92.54% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.86% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.68% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.40% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.37% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.35% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.30% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.14% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.82% | 99.15% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.23% | 95.78% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.52% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.13% | 96.21% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.84% | 89.67% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.26% | 94.00% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.75% | 94.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.69% | 96.95% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.30% | 95.64% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.00% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dianella nigra |
PubChem | 163191961 |
LOTUS | LTS0127566 |
wikiData | Q104909021 |