methyl (1S,4S,5R,9S,10S,12S,13R)-12-[(Z)-4-hydroxypent-3-enoyl]oxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate
| Internal ID | 13c892db-ac5f-4ef2-90c7-2d4b8f598dd0 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
| IUPAC Name | methyl (1S,4S,5R,9S,10S,12S,13R)-12-[(Z)-4-hydroxypent-3-enoyl]oxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES (Canonical) | CC(=CCC(=O)OC1CC2C3(CCCC(C3CCC24CC1C(=C)C4)(C)C(=O)OC)C)O |
| SMILES (Isomeric) | C/C(=C/CC(=O)O[C@H]1C[C@@H]2[C@@]3(CCC[C@@]([C@H]3CC[C@@]24C[C@@H]1C(=C)C4)(C)C(=O)OC)C)/O |
| InChI | InChI=1S/C26H38O5/c1-16-14-26-12-9-20-24(3,10-6-11-25(20,4)23(29)30-5)21(26)13-19(18(16)15-26)31-22(28)8-7-17(2)27/h7,18-21,27H,1,6,8-15H2,2-5H3/b17-7-/t18-,19+,20+,21-,24-,25-,26-/m1/s1 |
| InChI Key | PBWMJHXAKJRFOW-YOBIPLOTSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.27192431 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 5.20 |
| There are no found synonyms. |
![2D Structure of methyl (1S,4S,5R,9S,10S,12S,13R)-12-[(Z)-4-hydroxypent-3-enoyl]oxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/c56e8310-876f-11ee-b31d-a37429ac30fd.jpg "2D Structure of methyl (1S,4S,5R,9S,10S,12S,13R)-12-[(Z)-4-hydroxypent-3-enoyl]oxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.83% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.44% | 91.11% |
| CHEMBL240 | Q12809 | HERG | 94.54% | 89.76% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.64% | 95.17% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 91.44% | 91.07% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.27% | 94.45% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.75% | 91.19% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.24% | 90.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.28% | 97.25% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.88% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.71% | 95.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.76% | 93.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.49% | 95.50% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.02% | 91.24% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.02% | 92.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.54% | 94.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.29% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Milleria quinqueflora |
| Teucrium cossonii |
| PubChem | 162974714 |
| LOTUS | LTS0244071 |
| wikiData | Q105031504 |