[(5S)-5-hydroperoxy-7-hydroxy-2,4-dimethylideneheptyl] (2R)-3-[(2S,6R,8S,11R)-2-[(E,2R)-4-[(2S,2'R,4R,4aS,6R,8aR)-4-hydroxy-2-[(1S,3S)-1-hydroxy-3-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]butyl]-3-methylidenespiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-b]pyran-6,5'-oxolane]-2'-yl]but-3-en-2-yl]-11-hydroxy-4-methyl-1,7-dioxaspiro[5.5]undec-4-en-8-yl]-2-hydroxy-2-methylpropanoate
| Internal ID | eacedae4-10c0-4103-be90-41b3f50da6f1 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
| IUPAC Name | [(5S)-5-hydroperoxy-7-hydroxy-2,4-dimethylideneheptyl] (2R)-3-[(2S,6R,8S,11R)-2-[(E,2R)-4-[(2S,2'R,4R,4aS,6R,8aR)-4-hydroxy-2-[(1S,3S)-1-hydroxy-3-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]butyl]-3-methylidenespiro[4a,7,8,8a-tetrahydro-4H-pyrano[3,2-b]pyran-6,5'-oxolane]-2'-yl]but-3-en-2-yl]-11-hydroxy-4-methyl-1,7-dioxaspiro[5.5]undec-4-en-8-yl]-2-hydroxy-2-methylpropanoate |
| SMILES (Canonical) | CC1CCC2(CCCCO2)OC1C(C)CC(C3C(=C)C(C4C(O3)CCC5(O4)CCC(O5)C=CC(C)C6CC(=CC7(O6)C(CCC(O7)CC(C)(C(=O)OCC(=C)CC(=C)C(CCO)OO)O)O)C)O)O |
| SMILES (Isomeric) | C[C@@H]1CC[C@]2(CCCCO2)O[C@@H]1[C@@H](C)C[C@@H]([C@@H]3C(=C)[C@H]([C@H]4[C@H](O3)CC[C@]5(O4)CC[C@@H](O5)/C=C/[C@@H](C)[C@@H]6CC(=C[C@@]7(O6)[C@@H](CC[C@H](O7)C[C@](C)(C(=O)OCC(=C)CC(=C)[C@H](CCO)OO)O)O)C)O)O |
| InChI | InChI=1S/C53H82O16/c1-31-26-43(66-53(28-31)44(56)14-13-39(65-53)29-50(8,59)49(58)61-30-32(2)25-35(5)41(69-60)18-23-54)33(3)11-12-38-16-21-52(64-38)22-17-42-48(68-52)45(57)37(7)47(63-42)40(55)27-36(6)46-34(4)15-20-51(67-46)19-9-10-24-62-51/h11-12,28,33-34,36,38-48,54-57,59-60H,2,5,7,9-10,13-27,29-30H2,1,3-4,6,8H3/b12-11+/t33-,34-,36+,38+,39+,40+,41+,42-,43+,44-,45-,46+,47+,48-,50-,51+,52-,53-/m1/s1 |
| InChI Key | LZSACGSEJDYUGC-GTKHNMMUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C53H82O16 |
| Molecular Weight | 975.20 g/mol |
| Exact Mass | 974.56028652 g/mol |
| Topological Polar Surface Area (TPSA) | 222.00 Ų |
| XlogP | 4.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.63% | 89.63% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.42% | 91.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 98.08% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.69% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.15% | 96.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 97.00% | 96.47% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 96.96% | 91.24% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.27% | 97.25% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 95.07% | 92.88% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.22% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.71% | 93.56% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 93.16% | 93.03% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.98% | 94.73% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.15% | 96.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.55% | 83.82% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.32% | 99.17% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.49% | 96.90% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 88.83% | 89.67% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.74% | 100.00% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 88.37% | 97.50% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 87.94% | 98.03% |
| CHEMBL5028 | O14672 | ADAM10 | 87.69% | 97.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.68% | 90.71% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 86.58% | 96.00% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 85.25% | 97.56% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 84.81% | 94.66% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.51% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.32% | 95.56% |
| CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 83.77% | 88.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.75% | 96.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.39% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.10% | 89.00% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 82.99% | 97.31% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.97% | 95.71% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.36% | 100.00% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 81.35% | 97.47% |
| CHEMBL3820 | P35557 | Hexokinase type IV | 81.31% | 91.96% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.02% | 97.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.93% | 100.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 80.74% | 98.10% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.23% | 98.75% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.22% | 98.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163047026 |
| LOTUS | LTS0217957 |
| wikiData | Q105160094 |