5,10,14-Trimethyl-15-[1-(4,5,6-trihydroxy-4,5-dimethyloxan-2-yl)ethyl]-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-7-en-9-one
Internal ID | 8a87d6f4-8c48-4212-b408-3f6f044ceb6f |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Pregnane steroids |
IUPAC Name | 5,10,14-trimethyl-15-[1-(4,5,6-trihydroxy-4,5-dimethyloxan-2-yl)ethyl]-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-7-en-9-one |
SMILES (Canonical) | CC(C1CCC2C1(CCC3C2C4C(O4)C5(C3(C(=O)C=CC5)C)C)C)C6CC(C(C(O6)O)(C)O)(C)O |
SMILES (Isomeric) | CC(C1CCC2C1(CCC3C2C4C(O4)C5(C3(C(=O)C=CC5)C)C)C)C6CC(C(C(O6)O)(C)O)(C)O |
InChI | InChI=1S/C29H44O6/c1-15(19-14-27(4,32)29(6,33)24(31)34-19)16-9-10-17-21-18(11-13-25(16,17)2)28(5)20(30)8-7-12-26(28,3)23-22(21)35-23/h7-8,15-19,21-24,31-33H,9-14H2,1-6H3 |
InChI Key | KPBVVXMQPMNEMP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H44O6 |
Molecular Weight | 488.70 g/mol |
Exact Mass | 488.31378912 g/mol |
Topological Polar Surface Area (TPSA) | 99.50 Ų |
XlogP | 4.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.75% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.04% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.04% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.46% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.02% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.89% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 92.81% | 98.95% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.63% | 90.71% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.48% | 94.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.40% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.85% | 95.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 89.48% | 93.04% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.94% | 96.61% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.37% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.11% | 89.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.59% | 96.77% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.52% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.12% | 86.33% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 84.01% | 80.96% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.90% | 96.43% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.70% | 97.09% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 82.02% | 85.31% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.86% | 99.23% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.83% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.44% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.57% | 95.93% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.41% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mandragora officinarum |
PubChem | 162874756 |
LOTUS | LTS0073766 |
wikiData | Q105144102 |