(1R,2S,3S,5S,6R,8R,9S,11S,14S,16S,17S,18S)-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecane-2,3,6,18-tetrol
| Internal ID | 862b6dee-08f9-4188-bdd0-393129f41c79 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Villanovane, atisane, trachylobane or helvifulvane diterpenoids > Atisane diterpenoids |
| IUPAC Name | (1R,2S,3S,5S,6R,8R,9S,11S,14S,16S,17S,18S)-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecane-2,3,6,18-tetrol |
| SMILES (Canonical) | CC12CC(C(C34C1C5CC67C3(CC(CC6C4N5C2O)C(=C)C7)O)O)O |
| SMILES (Isomeric) | C[C@]12C[C@@H]([C@H]([C@]34[C@@H]1[C@@H]5C[C@]67[C@]3(C[C@H](C[C@@H]6[C@H]4N5[C@@H]2O)C(=C)C7)O)O)O |
| InChI | InChI=1S/C20H27NO4/c1-8-4-18-6-11-13-17(2)7-12(22)15(23)20(13)14(21(11)16(17)24)10(18)3-9(8)5-19(18,20)25/h9-16,22-25H,1,3-7H2,2H3/t9-,10+,11-,12-,13+,14+,15+,16+,17-,18-,19-,20+/m0/s1 |
| InChI Key | FQPRSAQZPQSWKW-NZWBKAGASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.19400834 g/mol |
| Topological Polar Surface Area (TPSA) | 84.20 Ų |
| XlogP | -0.10 |
| There are no found synonyms. |
![2D Structure of (1R,2S,3S,5S,6R,8R,9S,11S,14S,16S,17S,18S)-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecane-2,3,6,18-tetrol](https://plantaedb.com/storage/docs/compounds/2023/11/c4a81d10-8741-11ee-b266-a9097b786310.jpg "2D Structure of (1R,2S,3S,5S,6R,8R,9S,11S,14S,16S,17S,18S)-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecane-2,3,6,18-tetrol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.24% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.62% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.57% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.72% | 91.11% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.56% | 82.69% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.84% | 90.17% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.09% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.50% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.98% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.47% | 94.45% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.20% | 96.43% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.43% | 96.77% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.04% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aconitum septentrionale |
| PubChem | 162921524 |
| LOTUS | LTS0073664 |
| wikiData | Q104999777 |