(2R)-2-[[(2S)-2-[[2-[[2-[1-[[(1S)-5-[(4-amino-3-hydroxy-4-oxobutanoyl)amino]-8-hydroxy-9-oxo-1,2,3,4-tetrahydropyrimido[1,2-a]quinoline-1-carbonyl]amino]-2-hydroxyethyl]-1,4,5,6-tetrahydropyrimidine-6-carbonyl]amino]acetyl]amino]-3-hydroxypropanoyl]-hydroxyamino]-N-[(2S)-1-[[2-[[(2R)-1-[[2-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]butanediamide
| Internal ID | a9b4b77f-3e0e-4b28-9c2c-e45b9ab3a271 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | (2R)-2-[[(2S)-2-[[2-[[2-[1-[[(1S)-5-[(4-amino-3-hydroxy-4-oxobutanoyl)amino]-8-hydroxy-9-oxo-1,2,3,4-tetrahydropyrimido[1,2-a]quinoline-1-carbonyl]amino]-2-hydroxyethyl]-1,4,5,6-tetrahydropyrimidine-6-carbonyl]amino]acetyl]amino]-3-hydroxypropanoyl]-hydroxyamino]-N-[(2S)-1-[[2-[[(2R)-1-[[2-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]butanediamide |
| SMILES (Canonical) | CC(C(=O)NCC(=O)NC1CCCN(C1=O)O)NC(=O)CNC(=O)C(C)NC(=O)C(CC(=O)N)N(C(=O)C(CO)NC(=O)CNC(=O)C2CCN=C(N2)C(CO)NC(=O)C3CCNC4=C(C=C5C=C(C(=O)C=C5N34)O)NC(=O)CC(C(=O)N)O)O |
| SMILES (Isomeric) | C[C@H](C(=O)NCC(=O)N[C@H]1CCCN(C1=O)O)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@@H](CC(=O)N)N(C(=O)[C@H](CO)NC(=O)CNC(=O)C2CCN=C(N2)C(CO)NC(=O)[C@@H]3CCNC4=C(C=C5C=C(C(=O)C=C5N34)O)NC(=O)CC(C(=O)N)O)O |
| InChI | InChI=1S/C48H67N17O20/c1-20(42(77)54-16-37(74)58-24-4-3-9-63(84)47(24)82)56-36(73)15-53-43(78)21(2)57-46(81)30(13-34(49)71)65(85)48(83)27(19-67)60-38(75)17-55-44(79)23-5-7-51-40(61-23)26(18-66)62-45(80)28-6-8-52-41-25(59-35(72)14-33(70)39(50)76)10-22-11-31(68)32(69)12-29(22)64(28)41/h10-12,20-21,23-24,26-28,30,33,52,66-68,70,84-85H,3-9,13-19H2,1-2H3,(H2,49,71)(H2,50,76)(H,51,61)(H,53,78)(H,54,77)(H,55,79)(H,56,73)(H,57,81)(H,58,74)(H,59,72)(H,60,75)(H,62,80)/t20-,21+,23?,24+,26?,27+,28+,30-,33?/m1/s1 |
| InChI Key | RWLGLNKWSVDAQH-MLNIRCADSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C48H67N17O20 |
| Molecular Weight | 1202.10 g/mol |
| Exact Mass | 1201.47482759 g/mol |
| Topological Polar Surface Area (TPSA) | 567.00 Ų |
| XlogP | -9.80 |
| Atomic LogP (AlogP) | -9.78 |
| H-Bond Acceptor | 24 |
| H-Bond Donor | 19 |
| Rotatable Bonds | 27 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7869 | 78.69% |
| Caco-2 | - | 0.8616 | 86.16% |
| Blood Brain Barrier | + | 0.5250 | 52.50% |
| Human oral bioavailability | - | 0.6286 | 62.86% |
| Subcellular localzation | Nucleus | 0.4985 | 49.85% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8228 | 82.28% |
| OATP1B3 inhibitior | + | 0.9362 | 93.62% |
| MATE1 inhibitior | - | 0.8200 | 82.00% |
| OCT2 inhibitior | - | 0.7500 | 75.00% |
| BSEP inhibitior | + | 0.8673 | 86.73% |
| P-glycoprotein inhibitior | + | 0.7421 | 74.21% |
| P-glycoprotein substrate | + | 0.8715 | 87.15% |
| CYP3A4 substrate | + | 0.7513 | 75.13% |
| CYP2C9 substrate | - | 0.8015 | 80.15% |
| CYP2D6 substrate | - | 0.8489 | 84.89% |
| CYP3A4 inhibition | + | 0.5457 | 54.57% |
| CYP2C9 inhibition | - | 0.7870 | 78.70% |
| CYP2C19 inhibition | - | 0.7454 | 74.54% |
| CYP2D6 inhibition | - | 0.8430 | 84.30% |
| CYP1A2 inhibition | - | 0.8167 | 81.67% |
| CYP2C8 inhibition | + | 0.8231 | 82.31% |
| CYP inhibitory promiscuity | - | 0.8573 | 85.73% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.7700 | 77.00% |
| Carcinogenicity (trinary) | Non-required | 0.5535 | 55.35% |
| Eye corrosion | - | 0.9826 | 98.26% |
| Eye irritation | - | 0.8966 | 89.66% |
| Skin irritation | - | 0.7648 | 76.48% |
| Skin corrosion | - | 0.9248 | 92.48% |
| Ames mutagenesis | - | 0.5100 | 51.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6570 | 65.70% |
| Micronuclear | + | 0.9500 | 95.00% |
| Hepatotoxicity | - | 0.5166 | 51.66% |
| skin sensitisation | - | 0.8426 | 84.26% |
| Respiratory toxicity | + | 0.8111 | 81.11% |
| Reproductive toxicity | + | 0.9111 | 91.11% |
| Mitochondrial toxicity | + | 0.9500 | 95.00% |
| Nephrotoxicity | - | 0.7708 | 77.08% |
| Acute Oral Toxicity (c) | III | 0.6057 | 60.57% |
| Estrogen receptor binding | + | 0.6616 | 66.16% |
| Androgen receptor binding | + | 0.7507 | 75.07% |
| Thyroid receptor binding | + | 0.5933 | 59.33% |
| Glucocorticoid receptor binding | + | 0.6557 | 65.57% |
| Aromatase binding | + | 0.7130 | 71.30% |
| PPAR gamma | + | 0.6848 | 68.48% |
| Honey bee toxicity | - | 0.6603 | 66.03% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.6582 | 65.82% |
| Fish aquatic toxicity | - | 0.7488 | 74.88% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.94% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.16% | 89.63% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.15% | 96.09% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.56% | 93.10% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 97.85% | 98.05% |
| CHEMBL204 | P00734 | Thrombin | 97.19% | 96.01% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.98% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.98% | 85.14% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 96.91% | 95.71% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 96.61% | 90.71% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 94.78% | 95.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.36% | 97.09% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 94.04% | 94.33% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 93.99% | 98.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.09% | 94.45% |
| CHEMBL236 | P41143 | Delta opioid receptor | 92.96% | 99.35% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 92.71% | 97.64% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.65% | 89.00% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 92.01% | 97.56% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 90.67% | 98.24% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.84% | 97.14% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 89.67% | 89.34% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.26% | 96.38% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.23% | 99.17% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 89.05% | 91.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.04% | 99.23% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.90% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.50% | 95.89% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 87.23% | 80.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.20% | 90.08% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.20% | 94.75% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 87.03% | 98.57% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 86.63% | 97.47% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 86.22% | 94.45% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 85.98% | 96.11% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.66% | 96.47% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 84.73% | 93.33% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 84.31% | 96.03% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.63% | 93.03% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 83.59% | 97.50% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.57% | 95.83% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.22% | 96.90% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.17% | 93.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.68% | 91.19% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.05% | 100.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 81.65% | 98.59% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.54% | 96.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.42% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.37% | 99.15% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.58% | 92.94% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.41% | 99.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163185648 |
| LOTUS | LTS0147248 |
| wikiData | Q105246558 |