(2S,3S,4S)-3-ethenyl-4-[2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxyethyl]-2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylic acid
| Internal ID | bd27b68d-eaaf-4bdb-ade4-82969bdfe34b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
| IUPAC Name | (2S,3S,4S)-3-ethenyl-4-[2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxyethyl]-2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylic acid |
| SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)OCCC2C(C(OC=C2C(=O)O)OC3C(C(C(C(O3)CO)O)O)O)C=C)O |
| SMILES (Isomeric) | COC1=C(C=CC(=C1)/C=C/C(=O)OCC[C@H]2[C@@H]([C@@H](OC=C2C(=O)O)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C=C)O |
| InChI | InChI=1S/C26H32O13/c1-3-14-15(8-9-36-20(29)7-5-13-4-6-17(28)18(10-13)35-2)16(24(33)34)12-37-25(14)39-26-23(32)22(31)21(30)19(11-27)38-26/h3-7,10,12,14-15,19,21-23,25-28,30-32H,1,8-9,11H2,2H3,(H,33,34)/b7-5+/t14-,15-,19+,21+,22-,23-,25-,26-/m0/s1 |
| InChI Key | PLTGIFOLPHETSZ-MOJOKITASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H32O13 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.18429107 g/mol |
| Topological Polar Surface Area (TPSA) | 202.00 Ų |
| XlogP | 0.60 |
| There are no found synonyms. |
![2D Structure of (2S,3S,4S)-3-ethenyl-4-[2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxyethyl]-2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/c3d85e00-8725-11ee-8c9e-619aef2ab466.jpg "2D Structure of (2S,3S,4S)-3-ethenyl-4-[2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxyethyl]-2-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.47% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.04% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.71% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.52% | 96.09% |
| CHEMBL3194 | P02766 | Transthyretin | 95.61% | 90.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.04% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.90% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.13% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.60% | 95.56% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.72% | 89.62% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 87.49% | 94.45% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.57% | 90.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.22% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.03% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Anthocleista grandiflora |
| PubChem | 163105528 |
| LOTUS | LTS0154061 |
| wikiData | Q105211227 |