[(4R,8R)-2,12-dimethyl-7-methylidene-6-oxo-5,11,13,14-tetraoxatetracyclo[10.2.2.01,10.04,8]hexadecan-15-yl] acetate
| Internal ID | 7f170b8e-63cf-4135-a1ab-7527a6896705 |
| Taxonomy | Organoheterocyclic compounds > Trioxanes |
| IUPAC Name | [(4R,8R)-2,12-dimethyl-7-methylidene-6-oxo-5,11,13,14-tetraoxatetracyclo[10.2.2.01,10.04,8]hexadecan-15-yl] acetate |
| SMILES (Canonical) | CC1CC2C(CC3C14C(CC(O3)(OO4)C)OC(=O)C)C(=C)C(=O)O2 |
| SMILES (Isomeric) | CC1C[C@@H]2[C@H](CC3C14C(CC(O3)(OO4)C)OC(=O)C)C(=C)C(=O)O2 |
| InChI | InChI=1S/C17H22O7/c1-8-5-12-11(9(2)15(19)21-12)6-13-17(8)14(20-10(3)18)7-16(4,22-13)23-24-17/h8,11-14H,2,5-7H2,1,3-4H3/t8?,11-,12-,13?,14?,16?,17?/m1/s1 |
| InChI Key | CDOHRPYTUXZGEQ-QOOFHYPJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.13655304 g/mol |
| Topological Polar Surface Area (TPSA) | 80.30 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.19% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.89% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.38% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.35% | 94.45% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.31% | 97.79% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.20% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.28% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.27% | 91.19% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.59% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.59% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.83% | 92.94% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.46% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.95% | 89.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.79% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Xanthium strumarium |
| PubChem | 163081903 |
| LOTUS | LTS0082359 |
| wikiData | Q104954680 |