[(3R,4aS,10aS)-6-methoxy-1,1,4a-trimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-3-yl] acetate
Internal ID | 44297daf-d71b-4f73-8171-289a85f7ec2b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | [(3R,4aS,10aS)-6-methoxy-1,1,4a-trimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-3-yl] acetate |
SMILES (Canonical) | CC(C)C1=C(C=C2C(=C1)C(=O)CC3C2(CC(CC3(C)C)OC(=O)C)C)OC |
SMILES (Isomeric) | CC(C)C1=C(C=C2C(=C1)C(=O)C[C@@H]3[C@@]2(C[C@@H](CC3(C)C)OC(=O)C)C)OC |
InChI | InChI=1S/C23H32O4/c1-13(2)16-8-17-18(9-20(16)26-7)23(6)12-15(27-14(3)24)11-22(4,5)21(23)10-19(17)25/h8-9,13,15,21H,10-12H2,1-7H3/t15-,21+,23-/m1/s1 |
InChI Key | ABEYRUZXTWMTSC-LDLFBNOTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H32O4 |
Molecular Weight | 372.50 g/mol |
Exact Mass | 372.23005950 g/mol |
Topological Polar Surface Area (TPSA) | 52.60 Ų |
XlogP | 5.00 |
There are no found synonyms. |
![2D Structure of [(3R,4aS,10aS)-6-methoxy-1,1,4a-trimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-3-yl] acetate 2D Structure of [(3R,4aS,10aS)-6-methoxy-1,1,4a-trimethyl-9-oxo-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-3-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/c346abb0-860b-11ee-866e-b9a836b7b260.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.52% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.89% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 97.51% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.43% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.32% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 94.28% | 98.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.59% | 91.19% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.37% | 82.69% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.96% | 95.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.94% | 91.07% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.71% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.12% | 86.33% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.62% | 96.95% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.96% | 89.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.75% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.35% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.11% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.95% | 94.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.84% | 98.75% |
CHEMBL1907 | P15144 | Aminopeptidase N | 82.15% | 93.31% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.05% | 97.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.13% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Prumnopitys ferruginea |
PubChem | 162892806 |
LOTUS | LTS0136135 |
wikiData | Q104908578 |