17-(6-methoxy-6-methylhept-4-en-2-yl)-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol
Internal ID | 711c6fb0-87bd-4122-92b1-2fc6eb766142 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | 17-(6-methoxy-6-methylhept-4-en-2-yl)-4,4,9,13,14-pentamethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
SMILES (Canonical) | CC(CC=CC(C)(C)OC)C1CCC2(C1(CCC3(C2C(C=C4C3CCC(C4(C)C)O)O)C)C)C |
SMILES (Isomeric) | CC(CC=CC(C)(C)OC)C1CCC2(C1(CCC3(C2C(C=C4C3CCC(C4(C)C)O)O)C)C)C |
InChI | InChI=1S/C31H52O3/c1-20(11-10-15-27(2,3)34-9)21-14-16-31(8)26-24(32)19-23-22(12-13-25(33)28(23,4)5)29(26,6)17-18-30(21,31)7/h10,15,19-22,24-26,32-33H,11-14,16-18H2,1-9H3 |
InChI Key | JITGKINHLQAZRO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H52O3 |
Molecular Weight | 472.70 g/mol |
Exact Mass | 472.39164552 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 6.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.29% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.06% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.89% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.76% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.23% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 91.28% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.55% | 97.09% |
CHEMBL1977 | P11473 | Vitamin D receptor | 86.74% | 99.43% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.71% | 86.33% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 86.01% | 87.45% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.99% | 91.03% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.93% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.84% | 91.07% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.68% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.99% | 94.75% |
CHEMBL5028 | O14672 | ADAM10 | 82.35% | 97.50% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.06% | 97.79% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.31% | 100.00% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 80.85% | 96.25% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.79% | 93.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.42% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.17% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Momordica charantia |
PubChem | 73236884 |
LOTUS | LTS0114549 |
wikiData | Q105129316 |