[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl] (4aS,6aR,6aR,6bR,8aR,10S,12aR,14aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate
Internal ID | a0f7037a-1fb7-4ea8-bf8c-2977f3ebc809 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl] (4aS,6aR,6aR,6bR,8aR,10S,12aR,14aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC(=O)C34CCC(CC3C5CCC6C7(CCC(C(C7CCC6(C5(CC4)C)C)(C)C)OC8C(C(C(CO8)O)O)O)C)(C)C)COC9C(C(C(C(O9)CO)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC(=O)[C@@]34CC[C@@]5([C@@H]([C@@H]3CC(CC4)(C)C)CC[C@H]6[C@]5(CC[C@@H]7[C@@]6(CC[C@@H](C7(C)C)O[C@H]8[C@@H]([C@H]([C@H](CO8)O)O)O)C)C)C)CO[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C53H88O21/c1-23-32(56)36(60)41(65)45(69-23)73-42-38(62)35(59)28(22-68-43-40(64)37(61)34(58)27(20-54)70-43)71-46(42)74-47(66)53-17-15-48(2,3)19-25(53)24-9-10-30-50(6)13-12-31(72-44-39(63)33(57)26(55)21-67-44)49(4,5)29(50)11-14-52(30,8)51(24,7)16-18-53/h23-46,54-65H,9-22H2,1-8H3/t23-,24+,25-,26-,27+,28+,29-,30+,31-,32-,33-,34+,35+,36+,37-,38-,39+,40+,41+,42+,43+,44-,45-,46-,50-,51+,52+,53-/m0/s1 |
InChI Key | XNHHIXOKTCFMHQ-YQDMODAUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C53H88O21 |
Molecular Weight | 1061.30 g/mol |
Exact Mass | 1060.58180981 g/mol |
Topological Polar Surface Area (TPSA) | 334.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl] (4aS,6aR,6aR,6bR,8aR,10S,12aR,14aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate 2D Structure of [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl] (4aS,6aR,6aR,6bR,8aR,10S,12aR,14aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-[(2S,3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14,14a,14b-hexadecahydropicene-4a-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/c2f416d0-853b-11ee-ab1f-b15b00ce3635.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.67% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.67% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.78% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.91% | 96.61% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.51% | 97.36% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.16% | 95.93% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.05% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.35% | 97.25% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.30% | 95.50% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.41% | 86.92% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.30% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.51% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 86.73% | 98.95% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.34% | 91.24% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.01% | 96.77% |
CHEMBL233 | P35372 | Mu opioid receptor | 85.26% | 97.93% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.00% | 92.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.90% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.82% | 92.94% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 84.19% | 92.98% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 83.53% | 95.00% |
CHEMBL5028 | O14672 | ADAM10 | 83.25% | 97.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.15% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.13% | 95.83% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 82.86% | 97.86% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.79% | 96.38% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 82.22% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.78% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.32% | 94.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.11% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cephalaria scoparia |
PubChem | 162935971 |
LOTUS | LTS0203173 |
wikiData | Q105331662 |