[12-Acetyloxy-14-butanoyloxy-3-(1-methoxy-1-oxopropan-2-yl)-7,11,15-trimethyl-2-oxo-4-oxatricyclo[9.4.0.03,5]pentadec-6-en-10-yl] butanoate
| Internal ID | b304eb3a-f317-480f-8cfe-6d0c682aa55b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Briarane diterpenoids |
| IUPAC Name | [12-acetyloxy-14-butanoyloxy-3-(1-methoxy-1-oxopropan-2-yl)-7,11,15-trimethyl-2-oxo-4-oxatricyclo[9.4.0.03,5]pentadec-6-en-10-yl] butanoate |
| SMILES (Canonical) | CCCC(=O)OC1CCC(=CC2C(O2)(C(=O)C3C1(C(CC(C3C)OC(=O)CCC)OC(=O)C)C)C(C)C(=O)OC)C |
| SMILES (Isomeric) | CCCC(=O)OC1CCC(=CC2C(O2)(C(=O)C3C1(C(CC(C3C)OC(=O)CCC)OC(=O)C)C)C(C)C(=O)OC)C |
| InChI | InChI=1S/C31H46O10/c1-9-11-25(33)39-21-16-23(38-20(6)32)30(7)22(40-26(34)12-10-2)14-13-17(3)15-24-31(41-24,19(5)29(36)37-8)28(35)27(30)18(21)4/h15,18-19,21-24,27H,9-14,16H2,1-8H3 |
| InChI Key | LWLQPKMGWLUQFN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H46O10 |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.30909766 g/mol |
| Topological Polar Surface Area (TPSA) | 135.00 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.50% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.49% | 91.11% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.26% | 89.63% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.84% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.99% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.67% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.14% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.57% | 97.09% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.47% | 92.62% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.42% | 91.19% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.30% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.75% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.16% | 99.17% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.77% | 97.79% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.23% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.55% | 86.33% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.85% | 92.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.27% | 89.00% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 84.27% | 98.03% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.52% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.51% | 95.89% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.17% | 94.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.48% | 96.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.67% | 97.14% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.74% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73818028 |
| LOTUS | LTS0160470 |
| wikiData | Q105158390 |