(13-Acetyloxy-6-hydroxy-3,8-dimethyl-12-methylidene-4,11-dioxo-10-oxatricyclo[7.3.1.03,7]tridecan-2-yl) 2-methylbut-2-enoate
| Internal ID | 770fabe1-7605-43ab-8d7a-68bc96f961bf |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | (13-acetyloxy-6-hydroxy-3,8-dimethyl-12-methylidene-4,11-dioxo-10-oxatricyclo[7.3.1.03,7]tridecan-2-yl) 2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1C2C(C(C(C3C1(C(=O)CC3O)C)C)OC(=O)C2=C)OC(=O)C |
| SMILES (Isomeric) | CC=C(C)C(=O)OC1C2C(C(C(C3C1(C(=O)CC3O)C)C)OC(=O)C2=C)OC(=O)C |
| InChI | InChI=1S/C22H28O8/c1-7-9(2)20(26)30-19-15-10(3)21(27)29-17(18(15)28-12(5)23)11(4)16-13(24)8-14(25)22(16,19)6/h7,11,13,15-19,24H,3,8H2,1-2,4-6H3 |
| InChI Key | WDISZEOAIVKJTA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.17841785 g/mol |
| Topological Polar Surface Area (TPSA) | 116.00 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
![2D Structure of (13-Acetyloxy-6-hydroxy-3,8-dimethyl-12-methylidene-4,11-dioxo-10-oxatricyclo[7.3.1.03,7]tridecan-2-yl) 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/c2a78bd0-85b6-11ee-8549-e76a798df45c.jpg "2D Structure of (13-Acetyloxy-6-hydroxy-3,8-dimethyl-12-methylidene-4,11-dioxo-10-oxatricyclo[7.3.1.03,7]tridecan-2-yl) 2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.40% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.23% | 90.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.42% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.71% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.62% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.73% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.94% | 92.94% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.62% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.73% | 96.09% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.37% | 95.50% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.26% | 98.95% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 85.04% | 95.92% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.01% | 91.07% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.08% | 97.79% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.84% | 97.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.04% | 89.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.94% | 93.00% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.84% | 96.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.50% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Tetraneuris ivesiana |
| Tetraneuris linearifolia |
| PubChem | 162887338 |
| LOTUS | LTS0239758 |
| wikiData | Q105302391 |