27-(1-Hydroxyethyl)-30-(1-hydroxy-2-methylhex-4-enyl)-1,4,7,9,12,16,22,25-octamethyl-3,6,15,21-tetrakis(2-methylpropyl)-18,33-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
| Internal ID | c6a66fe4-fea5-4b8e-89f8-68ca93ebe077 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 27-(1-hydroxyethyl)-30-(1-hydroxy-2-methylhex-4-enyl)-1,4,7,9,12,16,22,25-octamethyl-3,6,15,21-tetrakis(2-methylpropyl)-18,33-di(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone |
| SMILES (Canonical) | CC=CCC(C)C(C1C(=O)NC(C(=O)N(CC(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C)C(C)O)O |
| SMILES (Isomeric) | CC=CCC(C)C(C1C(=O)NC(C(=O)N(CC(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C)C(C)O)O |
| InChI | InChI=1S/C61H109N11O13/c1-24-25-26-38(14)51(75)49-55(79)65-48(41(17)73)60(84)67(18)31-46(74)68(19)42(27-32(2)3)54(78)64-47(36(10)11)61(85)69(20)43(28-33(4)5)53(77)62-39(15)52(76)63-40(16)57(81)70(21)44(29-34(6)7)58(82)71(22)45(30-35(8)9)59(83)72(23)50(37(12)13)56(80)66-49/h24-25,32-45,47-51,73,75H,26-31H2,1-23H3,(H,62,77)(H,63,76)(H,64,78)(H,65,79)(H,66,80) |
| InChI Key | TZCUXJXFGWPMBF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C61H109N11O13 |
| Molecular Weight | 1204.60 g/mol |
| Exact Mass | 1203.82063257 g/mol |
| Topological Polar Surface Area (TPSA) | 308.00 Ų |
| XlogP | 6.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1949 | P62937 | Cyclophilin A | 98.96% | 98.57% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.93% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.50% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.92% | 90.08% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.45% | 94.75% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.05% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.31% | 95.56% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 89.73% | 92.12% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.24% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.85% | 97.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.69% | 90.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.56% | 85.14% |
| CHEMBL4072 | P07858 | Cathepsin B | 84.76% | 93.67% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 84.69% | 90.93% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 83.83% | 96.31% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.94% | 95.71% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 82.05% | 94.66% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 81.73% | 94.50% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.70% | 88.56% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.52% | 89.67% |
| CHEMBL228 | P31645 | Serotonin transporter | 81.38% | 95.51% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.82% | 97.79% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 80.72% | 98.59% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.44% | 93.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.14% | 95.93% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.12% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 75015786 |
| LOTUS | LTS0192855 |
| wikiData | Q105268016 |