(2S,4S)-2-(dimethylamino)-N-[(3S,4R,7R,10Z)-7-[(R)-hydroxy(phenyl)methyl]-5,8-dioxo-3-propan-2-yl-2-oxa-6,9-diazabicyclo[10.2.2]hexadeca-1(14),10,12,15-tetraen-4-yl]-4-methylhexanamide
| Internal ID | 427223a8-3414-442d-9ebb-e12d004e7262 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | (2S,4S)-2-(dimethylamino)-N-[(3S,4R,7R,10Z)-7-[(R)-hydroxy(phenyl)methyl]-5,8-dioxo-3-propan-2-yl-2-oxa-6,9-diazabicyclo[10.2.2]hexadeca-1(14),10,12,15-tetraen-4-yl]-4-methylhexanamide |
| SMILES (Canonical) | CCC(C)CC(C(=O)NC1C(OC2=CC=C(C=C2)C=CNC(=O)C(NC1=O)C(C3=CC=CC=C3)O)C(C)C)N(C)C |
| SMILES (Isomeric) | CC[C@H](C)C[C@@H](C(=O)N[C@@H]1[C@@H](OC2=CC=C(C=C2)/C=C\NC(=O)[C@H](NC1=O)[C@@H](C3=CC=CC=C3)O)C(C)C)N(C)C |
| InChI | InChI=1S/C32H44N4O5/c1-7-21(4)19-25(36(5)6)30(38)35-27-29(20(2)3)41-24-15-13-22(14-16-24)17-18-33-31(39)26(34-32(27)40)28(37)23-11-9-8-10-12-23/h8-18,20-21,25-29,37H,7,19H2,1-6H3,(H,33,39)(H,34,40)(H,35,38)/b18-17-/t21-,25-,26+,27+,28+,29-/m0/s1 |
| InChI Key | LXADJSSMLIATRP-QEEUFPDTSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C32H44N4O5 |
| Molecular Weight | 564.70 g/mol |
| Exact Mass | 564.33117052 g/mol |
| Topological Polar Surface Area (TPSA) | 120.00 Ų |
| XlogP | 5.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.39% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.45% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.32% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.49% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.45% | 95.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.15% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.95% | 99.17% |
| CHEMBL3837 | P07711 | Cathepsin L | 90.84% | 96.61% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.20% | 85.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.31% | 91.19% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.47% | 99.23% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.74% | 96.47% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.31% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.89% | 94.73% |
| CHEMBL5028 | O14672 | ADAM10 | 81.84% | 97.50% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.71% | 90.08% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.39% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Scutia buxifolia |
| PubChem | 163188154 |
| LOTUS | LTS0098227 |
| wikiData | Q105158714 |