7-(2-Hydroxyethyl)-5-methyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecane-13,15-diol
| Internal ID | 740928dd-7ee1-4492-b542-019f485ed2fd |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Villanovane, atisane, trachylobane or helvifulvane diterpenoids > Atisane diterpenoids |
| IUPAC Name | 7-(2-hydroxyethyl)-5-methyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecane-13,15-diol |
| SMILES (Canonical) | CC12CCCC34C1CC(C56C3CC(CC5C4N(C2)CCO)C(=C)C6O)O |
| SMILES (Isomeric) | CC12CCCC34C1CC(C56C3CC(CC5C4N(C2)CCO)C(=C)C6O)O |
| InChI | InChI=1S/C22H33NO3/c1-12-13-8-14-18-21-5-3-4-20(2,11-23(18)6-7-24)15(21)10-17(25)22(14,19(12)26)16(21)9-13/h13-19,24-26H,1,3-11H2,2H3 |
| InChI Key | QRHMNGZFPHCNKA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.24604391 g/mol |
| Topological Polar Surface Area (TPSA) | 63.90 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
![2D Structure of 7-(2-Hydroxyethyl)-5-methyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecane-13,15-diol](https://plantaedb.com/storage/docs/compounds/2023/11/c263b550-8588-11ee-81ec-55cd5548e61c.jpg "2D Structure of 7-(2-Hydroxyethyl)-5-methyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecane-13,15-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.90% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.96% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.48% | 83.82% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.26% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.49% | 97.09% |
| CHEMBL233 | P35372 | Mu opioid receptor | 84.75% | 97.93% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.73% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.70% | 98.95% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.70% | 90.24% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.49% | 95.93% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.08% | 98.46% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.45% | 82.69% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.34% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.00% | 95.89% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 81.58% | 98.10% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 80.96% | 97.50% |
| CHEMBL238 | Q01959 | Dopamine transporter | 80.07% | 95.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aconitum nasutum |
| PubChem | 73805041 |
| LOTUS | LTS0166007 |
| wikiData | Q105226332 |