[15-(5-Ethyl-6-methylhept-6-en-2-yl)-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] octadec-9-enoate
| Internal ID | 34a4ada2-4edc-416b-9dd6-9c126770c303 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
| IUPAC Name | [15-(5-ethyl-6-methylhept-6-en-2-yl)-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] octadec-9-enoate |
| SMILES (Canonical) | CCCCCCCCC=CCCCCCCCC(=O)OC1CCC23CC24CCC5(C(CCC5(C4CCC3C1(C)C)C)C(C)CCC(CC)C(=C)C)C |
| SMILES (Isomeric) | CCCCCCCCC=CCCCCCCCC(=O)OC1CCC23CC24CCC5(C(CCC5(C4CCC3C1(C)C)C)C(C)CCC(CC)C(=C)C)C |
| InChI | InChI=1S/C50H86O2/c1-10-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-45(51)52-44-32-34-49-37-50(49)36-35-47(8)41(39(5)27-28-40(11-2)38(3)4)31-33-48(47,9)43(50)30-29-42(49)46(44,6)7/h18-19,39-44H,3,10-17,20-37H2,1-2,4-9H3 |
| InChI Key | MLBFWTKVFWKCPU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C50H86O2 |
| Molecular Weight | 719.20 g/mol |
| Exact Mass | 718.66278198 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 19.00 |
| There are no found synonyms. |
![2D Structure of [15-(5-Ethyl-6-methylhept-6-en-2-yl)-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] octadec-9-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/c24fad00-855b-11ee-bf1b-15d13b23cda5.jpg "2D Structure of [15-(5-Ethyl-6-methylhept-6-en-2-yl)-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] octadec-9-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.43% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.89% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.34% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.20% | 91.11% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.80% | 95.17% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.32% | 92.86% |
| CHEMBL240 | Q12809 | HERG | 96.08% | 89.76% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.76% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.47% | 98.95% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.51% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.98% | 97.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.88% | 93.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.37% | 100.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 92.20% | 97.79% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.78% | 96.47% |
| CHEMBL233 | P35372 | Mu opioid receptor | 91.39% | 97.93% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.11% | 92.50% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.07% | 95.71% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 90.97% | 98.03% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.74% | 91.19% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 90.64% | 94.66% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 90.52% | 85.94% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.98% | 93.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.01% | 96.95% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 88.98% | 82.50% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 87.96% | 91.81% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.79% | 95.50% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.53% | 82.69% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.13% | 96.38% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.10% | 92.62% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.82% | 96.25% |
| CHEMBL236 | P41143 | Delta opioid receptor | 83.81% | 99.35% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.73% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.60% | 97.09% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 83.58% | 96.00% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.94% | 94.78% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 82.81% | 97.50% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.25% | 90.08% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.03% | 94.33% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.68% | 98.75% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 81.50% | 99.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.16% | 89.00% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 80.32% | 92.98% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Goniophlebium mengtzeense |
| PubChem | 162887079 |
| LOTUS | LTS0199715 |
| wikiData | Q105166433 |