[3,5,7-triacetyloxy-8-(2-acetyloxy-3-hydroxy-3-methylpent-4-enyl)-4,4,7,8a-tetramethyl-2,3,4a,5,6,8-hexahydro-1H-naphthalen-2-yl] acetate
| Internal ID | 46c3adbe-077f-42dd-811b-31d83cfa5002 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | [3,5,7-triacetyloxy-8-(2-acetyloxy-3-hydroxy-3-methylpent-4-enyl)-4,4,7,8a-tetramethyl-2,3,4a,5,6,8-hexahydro-1H-naphthalen-2-yl] acetate |
| SMILES (Canonical) | CC(=O)OC1CC2(C(C(CC(C2C(C1OC(=O)C)(C)C)OC(=O)C)(C)OC(=O)C)CC(C(C)(C=C)O)OC(=O)C)C |
| SMILES (Isomeric) | CC(=O)OC1CC2(C(C(CC(C2C(C1OC(=O)C)(C)C)OC(=O)C)(C)OC(=O)C)CC(C(C)(C=C)O)OC(=O)C)C |
| InChI | InChI=1S/C30H46O11/c1-12-29(10,36)24(39-18(4)33)13-23-28(9)14-22(38-17(3)32)26(40-19(5)34)27(7,8)25(28)21(37-16(2)31)15-30(23,11)41-20(6)35/h12,21-26,36H,1,13-15H2,2-11H3 |
| InChI Key | PJZOYAIOGNEXPK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H46O11 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.30401228 g/mol |
| Topological Polar Surface Area (TPSA) | 152.00 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.34% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.23% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.99% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.40% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.34% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.41% | 91.19% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.37% | 91.07% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.88% | 86.33% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.70% | 94.33% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.65% | 97.28% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.58% | 89.34% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.84% | 97.29% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.75% | 96.95% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.60% | 89.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.31% | 95.89% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.79% | 91.03% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.39% | 91.24% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 83.09% | 92.95% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.23% | 98.75% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.15% | 97.21% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.01% | 99.17% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.17% | 95.71% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.08% | 85.14% |
| CHEMBL2061 | P19793 | Retinoid X receptor alpha | 80.98% | 91.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ptychanthus striatus |
| PubChem | 73810078 |
| LOTUS | LTS0223450 |
| wikiData | Q105210251 |