4-[(2S,3R,4R,6R)-6-[(2R,3R,4S,6S)-4-amino-6-[(2R,3R,4S,6S)-4-amino-6-[[(1S,10S,12R,21S,22R,23S,24R)-23-(dimethylamino)-10-[(2R,4R,5S,6R)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-8,12,15,22-tetrahydroxy-1,12-dimethyl-6,17-dioxo-20,25-dioxahexacyclo[19.3.1.02,19.05,18.07,16.09,14]pentacosa-2(19),3,5(18),7,9(14),15-hexaen-24-yl]oxy]-2,4-dimethyloxan-3-yl]oxy-2,4-dimethyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-oxobutanoic acid
| Internal ID | 926db3f5-8800-4ffb-a559-0912813529c2 |
| Taxonomy | Phenylpropanoids and polyketides > Anthracyclines |
| IUPAC Name | 4-[(2S,3R,4R,6R)-6-[(2R,3R,4S,6S)-4-amino-6-[(2R,3R,4S,6S)-4-amino-6-[[(1S,10S,12R,21S,22R,23S,24R)-23-(dimethylamino)-10-[(2R,4R,5S,6R)-4-(dimethylamino)-5-hydroxy-6-methyloxan-2-yl]oxy-8,12,15,22-tetrahydroxy-1,12-dimethyl-6,17-dioxo-20,25-dioxahexacyclo[19.3.1.02,19.05,18.07,16.09,14]pentacosa-2(19),3,5(18),7,9(14),15-hexaen-24-yl]oxy]-2,4-dimethyloxan-3-yl]oxy-2,4-dimethyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl]oxy-4-oxobutanoic acid |
| SMILES (Canonical) | CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C=CC6=C5OC7C(C(C(C6(O7)C)OC8CC(C(C(O8)C)OC9CC(C(C(O9)C)OC1CC(C(C(O1)C)OC(=O)CCC(=O)O)OC)(C)N)(C)N)N(C)C)O)O)(C)O)N(C)C)O |
| SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H](C[C@@H](O1)O[C@H]2C[C@](CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C=CC6=C5O[C@@H]7[C@@H]([C@@H]([C@H]([C@]6(O7)C)O[C@H]8C[C@]([C@H]([C@H](O8)C)O[C@H]9C[C@]([C@H]([C@H](O9)C)O[C@@H]1C[C@H]([C@@H]([C@@H](O1)C)OC(=O)CCC(=O)O)OC)(C)N)(C)N)N(C)C)O)O)(C)O)N(C)C)O |
| InChI | InChI=1S/C60H86N4O22/c1-24-45(68)31(63(9)10)18-36(76-24)80-33-21-57(5,74)20-29-40(33)48(71)42-43(47(29)70)49(72)41-28(46(42)69)14-15-30-52(41)85-56-50(73)44(64(11)12)55(60(30,8)86-56)84-39-23-59(7,62)54(27(4)79-39)83-38-22-58(6,61)53(26(3)78-38)82-37-19-32(75-13)51(25(2)77-37)81-35(67)17-16-34(65)66/h14-15,24-27,31-33,36-39,44-45,50-51,53-56,68,70-71,73-74H,16-23,61-62H2,1-13H3,(H,65,66)/t24-,25+,26-,27-,31-,32-,33+,36+,37-,38+,39+,44+,45-,50-,51-,53+,54+,55-,56+,57-,58+,59+,60+/m1/s1 |
| InChI Key | XMRHMVSZMLOUMS-WCRFGKPLSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C60H86N4O22 |
| Molecular Weight | 1215.30 g/mol |
| Exact Mass | 1214.57337038 g/mol |
| Topological Polar Surface Area (TPSA) | 359.00 Ų |
| XlogP | -0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.73% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.25% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.81% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.54% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.87% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.28% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.20% | 90.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.14% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.99% | 91.49% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.65% | 95.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.93% | 90.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.76% | 91.19% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.52% | 92.94% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.72% | 96.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.46% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.35% | 95.89% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 87.34% | 96.37% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.25% | 99.23% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 86.51% | 80.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.72% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.58% | 99.15% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.65% | 97.33% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.16% | 96.38% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.78% | 93.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.77% | 85.11% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 83.66% | 97.28% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.38% | 96.21% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 81.95% | 95.64% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.91% | 83.82% |
| CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 81.41% | 94.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139588917 |
| LOTUS | LTS0167928 |
| wikiData | Q105331374 |