(4S)-5-[[(2S,5S,8S,11R,12S,15S,18S,21R)-15-[3-(diaminomethylideneamino)propyl]-21-hydroxy-5-[(4-hydroxyphenyl)methyl]-4,11-dimethyl-2-(2-methylpropyl)-3,6,9,13,16,22-hexaoxo-8-propan-2-yl-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]amino]-4-(hexanoylamino)-5-oxopentanoic acid
| Internal ID | f04c8b41-b6da-4230-89e2-0a76fe2f1c20 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (4S)-5-[[(2S,5S,8S,11R,12S,15S,18S,21R)-15-[3-(diaminomethylideneamino)propyl]-21-hydroxy-5-[(4-hydroxyphenyl)methyl]-4,11-dimethyl-2-(2-methylpropyl)-3,6,9,13,16,22-hexaoxo-8-propan-2-yl-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]amino]-4-(hexanoylamino)-5-oxopentanoic acid |
| SMILES (Canonical) | CCCCCC(=O)NC(CCC(=O)O)C(=O)NC1C(OC(=O)C(NC(=O)C(N(C(=O)C(N2C(CCC(C2=O)NC(=O)C(NC1=O)CCCN=C(N)N)O)CC(C)C)C)CC3=CC=C(C=C3)O)C(C)C)C |
| SMILES (Isomeric) | CCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H]1[C@H](OC(=O)[C@@H](NC(=O)[C@@H](N(C(=O)[C@@H](N2[C@@H](CC[C@@H](C2=O)NC(=O)[C@@H](NC1=O)CCCN=C(N)N)O)CC(C)C)C)CC3=CC=C(C=C3)O)C(C)C)C |
| InChI | InChI=1S/C47H74N10O13/c1-8-9-10-13-35(59)51-31(19-21-37(61)62)41(64)55-39-27(6)70-46(69)38(26(4)5)54-42(65)33(24-28-14-16-29(58)17-15-28)56(7)45(68)34(23-25(2)3)57-36(60)20-18-32(44(57)67)53-40(63)30(52-43(39)66)12-11-22-50-47(48)49/h14-17,25-27,30-34,36,38-39,58,60H,8-13,18-24H2,1-7H3,(H,51,59)(H,52,66)(H,53,63)(H,54,65)(H,55,64)(H,61,62)(H4,48,49,50)/t27-,30+,31+,32+,33+,34+,36-,38+,39+/m1/s1 |
| InChI Key | IJAPBAZLQXFSLT-MYAMMQBASA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C47H74N10O13 |
| Molecular Weight | 987.10 g/mol |
| Exact Mass | 986.54368245 g/mol |
| Topological Polar Surface Area (TPSA) | 355.00 Ų |
| XlogP | 1.90 |
| DTXSID701335441 |
| 914606-79-4 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.93% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.67% | 83.82% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.34% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.28% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.30% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.11% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.70% | 90.71% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.37% | 90.08% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 94.60% | 93.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 94.54% | 96.61% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.46% | 95.89% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.49% | 92.08% |
| CHEMBL236 | P41143 | Delta opioid receptor | 93.37% | 99.35% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 92.67% | 99.52% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.61% | 93.56% |
| CHEMBL1949 | P62937 | Cyclophilin A | 91.73% | 98.57% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.51% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.46% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.32% | 95.89% |
| CHEMBL4072 | P07858 | Cathepsin B | 90.77% | 93.67% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 90.54% | 90.93% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 90.15% | 97.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 89.74% | 95.38% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.99% | 89.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 88.92% | 97.23% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.93% | 96.90% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 87.73% | 94.66% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 87.19% | 95.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 87.04% | 97.64% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.58% | 100.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 86.37% | 93.10% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.15% | 92.88% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.71% | 89.50% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.62% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.44% | 96.47% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.34% | 97.14% |
| CHEMBL3891 | P07384 | Calpain 1 | 85.27% | 93.04% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.26% | 82.38% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.28% | 86.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.10% | 100.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 83.85% | 92.32% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 83.03% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.87% | 99.23% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.30% | 90.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.35% | 91.19% |
| CHEMBL3776 | Q14790 | Caspase-8 | 80.92% | 97.06% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.62% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 44448129 |
| LOTUS | LTS0135562 |
| wikiData | Q105113866 |