[8a-(hydroxymethyl)-5-methyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,7-b]furan-8-yl] acetate
| Internal ID | befae2f9-39ed-4dc5-bd77-190c9484771d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Ambrosanolides and secoambrosanolides |
| IUPAC Name | [8a-(hydroxymethyl)-5-methyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,7-b]furan-8-yl] acetate |
| SMILES (Canonical) | CC1CC2C(CC3(C1CCC3OC(=O)C)CO)C(=C)C(=O)O2 |
| SMILES (Isomeric) | CC1CC2C(CC3(C1CCC3OC(=O)C)CO)C(=C)C(=O)O2 |
| InChI | InChI=1S/C17H24O5/c1-9-6-14-12(10(2)16(20)22-14)7-17(8-18)13(9)4-5-15(17)21-11(3)19/h9,12-15,18H,2,4-8H2,1,3H3 |
| InChI Key | ACNXNUFAMRWFQW-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.16237386 g/mol |
| Topological Polar Surface Area (TPSA) | 72.80 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
![2D Structure of [8a-(hydroxymethyl)-5-methyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,7-b]furan-8-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/c1c53180-8302-11ee-9b2d-9fbecd0ffc5d.jpg "2D Structure of [8a-(hydroxymethyl)-5-methyl-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,7-b]furan-8-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.86% | 85.14% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.30% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.11% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.76% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.99% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.93% | 94.45% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.94% | 94.80% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.03% | 95.56% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.96% | 97.79% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.76% | 86.33% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.79% | 98.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.55% | 99.23% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.25% | 100.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.05% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Rudbeckia mollis |
| Rudbeckia subtomentosa |
| PubChem | 73816673 |
| LOTUS | LTS0005597 |
| wikiData | Q104909200 |