4-(Dimethylamino)-5-hydroxy-3-methoxy-2-methyl-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-8,10,12,14,19,21,23,25,27-nonaen-16-one
| Internal ID | 95e3c8d9-a50c-47fa-bcf9-f7147408b977 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles > Pyrrolocarbazoles > Indolocarbazoles |
| IUPAC Name | 4-(dimethylamino)-5-hydroxy-3-methoxy-2-methyl-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-8,10,12,14,19,21,23,25,27-nonaen-16-one |
| SMILES (Canonical) | CC12C(C(C(C(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)O)N(C)C)OC |
| SMILES (Isomeric) | CC12C(C(C(C(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)O)N(C)C)OC |
| InChI | InChI=1S/C29H28N4O4/c1-29-26(36-4)24(31(2)3)25(34)28(37-29)32-17-11-7-5-9-14(17)20-21-16(13-30-27(21)35)19-15-10-6-8-12-18(15)33(29)23(19)22(20)32/h5-12,24-26,28,34H,13H2,1-4H3,(H,30,35) |
| InChI Key | NWBZGGZTDXTDIL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.21105539 g/mol |
| Topological Polar Surface Area (TPSA) | 80.90 Ų |
| XlogP | 2.70 |
| Atomic LogP (AlogP) | 3.67 |
| H-Bond Acceptor | 7 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 2 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5000 | 50.00% |
| Caco-2 | - | 0.6855 | 68.55% |
| Blood Brain Barrier | - | 0.5250 | 52.50% |
| Human oral bioavailability | - | 0.5714 | 57.14% |
| Subcellular localzation | Lysosomes | 0.5145 | 51.45% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8568 | 85.68% |
| OATP1B3 inhibitior | + | 0.9383 | 93.83% |
| MATE1 inhibitior | - | 0.8000 | 80.00% |
| OCT2 inhibitior | - | 0.9109 | 91.09% |
| BSEP inhibitior | + | 0.9398 | 93.98% |
| P-glycoprotein inhibitior | + | 0.7621 | 76.21% |
| P-glycoprotein substrate | + | 0.8479 | 84.79% |
| CYP3A4 substrate | + | 0.7218 | 72.18% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7494 | 74.94% |
| CYP3A4 inhibition | - | 0.5634 | 56.34% |
| CYP2C9 inhibition | - | 0.7757 | 77.57% |
| CYP2C19 inhibition | - | 0.7349 | 73.49% |
| CYP2D6 inhibition | - | 0.8842 | 88.42% |
| CYP1A2 inhibition | - | 0.5855 | 58.55% |
| CYP2C8 inhibition | + | 0.6239 | 62.39% |
| CYP inhibitory promiscuity | + | 0.5561 | 55.61% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9200 | 92.00% |
| Carcinogenicity (trinary) | Non-required | 0.6210 | 62.10% |
| Eye corrosion | - | 0.9886 | 98.86% |
| Eye irritation | - | 0.9546 | 95.46% |
| Skin irritation | - | 0.7965 | 79.65% |
| Skin corrosion | - | 0.9420 | 94.20% |
| Ames mutagenesis | + | 0.6500 | 65.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4439 | 44.39% |
| Micronuclear | + | 0.9000 | 90.00% |
| Hepatotoxicity | + | 0.6001 | 60.01% |
| skin sensitisation | - | 0.8847 | 88.47% |
| Respiratory toxicity | + | 0.8000 | 80.00% |
| Reproductive toxicity | + | 0.8444 | 84.44% |
| Mitochondrial toxicity | + | 0.8875 | 88.75% |
| Nephrotoxicity | - | 0.5621 | 56.21% |
| Acute Oral Toxicity (c) | III | 0.6103 | 61.03% |
| Estrogen receptor binding | + | 0.7349 | 73.49% |
| Androgen receptor binding | + | 0.6448 | 64.48% |
| Thyroid receptor binding | + | 0.6294 | 62.94% |
| Glucocorticoid receptor binding | + | 0.7640 | 76.40% |
| Aromatase binding | + | 0.7722 | 77.22% |
| PPAR gamma | + | 0.7153 | 71.53% |
| Honey bee toxicity | - | 0.6858 | 68.58% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | + | 0.6300 | 63.00% |
| Fish aquatic toxicity | - | 0.5610 | 56.10% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 99.20% | 81.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.99% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.81% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.18% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.87% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.17% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.75% | 89.00% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 96.72% | 95.64% |
| CHEMBL4924 | Q9UK32 | Ribosomal protein S6 kinase alpha 6 | 96.54% | 80.00% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 96.16% | 80.71% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 96.01% | 88.00% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 95.82% | 89.23% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 95.65% | 85.11% |
| CHEMBL2801 | Q13557 | CaM kinase II delta | 95.21% | 84.49% |
| CHEMBL4598 | Q13043 | Serine/threonine-protein kinase MST1 | 95.06% | 96.64% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 94.62% | 96.47% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 94.53% | 88.81% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 93.26% | 87.16% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.13% | 90.08% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 92.55% | 95.83% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 92.48% | 97.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.24% | 95.89% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 92.20% | 93.03% |
| CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 92.09% | 90.48% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.01% | 99.23% |
| CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 91.83% | 91.83% |
| CHEMBL4599 | Q07912 | Tyrosine kinase non-receptor protein 2 | 91.22% | 94.29% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.42% | 91.79% |
| CHEMBL5314 | Q06418 | Tyrosine-protein kinase receptor TYRO3 | 90.23% | 96.00% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 90.00% | 80.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.48% | 94.00% |
| CHEMBL3820 | P35557 | Hexokinase type IV | 88.94% | 91.96% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 88.77% | 83.10% |
| CHEMBL4237 | O75582 | Ribosomal protein S6 kinase alpha 5 | 88.72% | 91.00% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.58% | 96.00% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 88.32% | 90.95% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 87.91% | 81.58% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.04% | 98.75% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.87% | 97.14% |
| CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 86.75% | 83.65% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.64% | 93.99% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.34% | 96.67% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 85.07% | 88.56% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.32% | 91.07% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.04% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.64% | 86.33% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.18% | 98.59% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 82.08% | 82.86% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 81.98% | 85.49% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.51% | 96.77% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.27% | 93.00% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 80.49% | 82.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.24% | 97.09% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.23% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85065990 |
| LOTUS | LTS0092643 |
| wikiData | Q104180077 |