(3S,13R)-13-[(3S,6R,9S,12S,15R,18S,21S,25S)-3-[(2S)-butan-2-yl]-21-(2-carboxyethyl)-9-(carboxymethyl)-6,15,18-tris(2-methylpropyl)-2,5,8,11,14,17,20,23-octaoxo-12-propan-2-yl-1-oxa-4,7,10,13,16,19,22-heptazacyclopentacos-25-yl]-3-hydroxytetradecanoic acid
| Internal ID | ab510b48-4967-482a-a535-2ae340b9a5b8 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (3S,13R)-13-[(3S,6R,9S,12S,15R,18S,21S,25S)-3-[(2S)-butan-2-yl]-21-(2-carboxyethyl)-9-(carboxymethyl)-6,15,18-tris(2-methylpropyl)-2,5,8,11,14,17,20,23-octaoxo-12-propan-2-yl-1-oxa-4,7,10,13,16,19,22-heptazacyclopentacos-25-yl]-3-hydroxytetradecanoic acid |
| SMILES (Canonical) | CCC(C)C1C(=O)OC(CC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CC(C)C)CC(=O)O)C(C)C)CC(C)C)CC(C)C)CCC(=O)O)C(C)CCCCCCCCCC(CC(=O)O)O |
| SMILES (Isomeric) | CC[C@H](C)[C@H]1C(=O)O[C@@H](CC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N1)CC(C)C)CC(=O)O)C(C)C)CC(C)C)CC(C)C)CCC(=O)O)[C@H](C)CCCCCCCCC[C@@H](CC(=O)O)O |
| InChI | InChI=1S/C55H95N7O16/c1-12-34(10)48-55(77)78-42(35(11)20-18-16-14-13-15-17-19-21-36(63)27-45(67)68)29-43(64)56-37(22-23-44(65)66)49(71)57-38(24-30(2)3)50(72)58-39(25-31(4)5)52(74)61-47(33(8)9)54(76)60-41(28-46(69)70)51(73)59-40(26-32(6)7)53(75)62-48/h30-42,47-48,63H,12-29H2,1-11H3,(H,56,64)(H,57,71)(H,58,72)(H,59,73)(H,60,76)(H,61,74)(H,62,75)(H,65,66)(H,67,68)(H,69,70)/t34-,35+,36-,37-,38-,39+,40+,41-,42-,47-,48-/m0/s1 |
| InChI Key | CSJRBDJGUADNET-LWLYRBPCSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C55H95N7O16 |
| Molecular Weight | 1110.40 g/mol |
| Exact Mass | 1109.68352997 g/mol |
| Topological Polar Surface Area (TPSA) | 362.00 Ų |
| XlogP | 7.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.56% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.51% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.13% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.03% | 90.08% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.66% | 94.75% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 94.46% | 96.47% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.30% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.18% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.84% | 99.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.80% | 85.14% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 92.17% | 95.00% |
| CHEMBL236 | P41143 | Delta opioid receptor | 89.53% | 99.35% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.90% | 93.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.41% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.01% | 95.56% |
| CHEMBL4071 | P08311 | Cathepsin G | 87.97% | 94.64% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 87.74% | 94.66% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 87.56% | 82.38% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.07% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.51% | 99.23% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.10% | 96.90% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.84% | 97.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.60% | 97.29% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.84% | 90.71% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.83% | 93.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.67% | 95.50% |
| CHEMBL209 | P07477 | Trypsin I | 83.48% | 90.00% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.15% | 98.75% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 82.56% | 96.11% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.20% | 92.32% |
| CHEMBL1949 | P62937 | Cyclophilin A | 82.14% | 98.57% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 81.60% | 97.00% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 80.36% | 92.50% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.31% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162880519 |
| LOTUS | LTS0199016 |
| wikiData | Q104969360 |