C(14a)-Homo-27-norgammacer-13-en-21beta-ol, 3alpha-methoxy-
| Internal ID | 433ec090-ba27-41c3-922e-6c40508f598d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | 19-methoxy-1,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-3(12)-en-8-ol |
| SMILES (Canonical) | CC1(C2CCC3=C(C2(CCC1O)C)CCC4C(C3)(CCC5C4(CCC(C5(C)C)OC)C)C)C |
| SMILES (Isomeric) | CC1(C2CCC3=C(C2(CCC1O)C)CCC4C(C3)(CCC5C4(CCC(C5(C)C)OC)C)C)C |
| InChI | InChI=1S/C31H52O2/c1-27(2)22-11-9-20-19-29(5)16-13-23-28(3,4)26(33-8)15-18-31(23,7)24(29)12-10-21(20)30(22,6)17-14-25(27)32/h22-26,32H,9-19H2,1-8H3 |
| InChI Key | JVQAAEYVCFXXNB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.396730897 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 7.80 |
| C(14a)-Homo-27-norgammacer-13-en-21.beta.-ol, 3.alpha.-methoxy- |
| 3.alpha.-Methoxy-21.beta.-hydroxy-.delta.13-serratene |
| C(14a)-Homo-27-norgammacer-13-en-21-ol, 3-methoxy-, (3.alpha.,21.beta.)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.14% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.27% | 92.94% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.40% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.80% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.72% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.11% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 86.09% | 96.43% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.09% | 100.00% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.56% | 95.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.44% | 92.62% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 81.15% | 91.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Picea jezoensis |
| Picea sitchensis |
| PubChem | 550210 |
| LOTUS | LTS0266228 |
| wikiData | Q105135897 |