[C141, Man]Hassallidin D
Internal ID | 4a85b3fd-c5c2-4667-b1be-b8fadcef80ab |
Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides > Cyclic glycodepsipeptides |
IUPAC Name | 3-[(2S,3S,4R,5R)-4-[(2R,3S,4S,5R,6S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dihydroxyoxan-2-yl]oxy-N-[1-[[(3S,12R,15Z,18R,21S,24S,25R)-12-(3-amino-3-oxopropyl)-15-ethylidene-21-[(1S)-1-hydroxyethyl]-3,18-bis[(4-hydroxyphenyl)methyl]-7,25-dimethyl-2,5,8,11,14,17,20,23-octaoxo-6-[1-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-1-oxa-4,7,10,13,16,19,22-heptazacyclopentacos-24-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-2-hydroxytetradecanamide |
SMILES (Canonical) | CCCCCCCCCCCC(C(C(=O)NC(C(C)O)C(=O)NC1C(OC(=O)C(NC(=O)C(N(C(=O)CNC(=O)C(NC(=O)C(=CC)NC(=O)C(NC(=O)C(NC1=O)C(C)O)CC2=CC=C(C=C2)O)CCC(=O)N)C)C(C)OC3C(C(C(C(O3)CO)O)O)O)CC4=CC=C(C=C4)O)C)O)OC5C(C(C(CO5)O)OC6C(C(C(C(O6)CO)O)O)NC(=O)C)O |
SMILES (Isomeric) | CCCCCCCCCCCC(C(C(=O)NC(C(C)O)C(=O)N[C@H]1[C@H](OC(=O)[C@@H](NC(=O)C(N(C(=O)CNC(=O)[C@H](NC(=O)/C(=C/C)/NC(=O)[C@H](NC(=O)[C@@H](NC1=O)[C@H](C)O)CC2=CC=C(C=C2)O)CCC(=O)N)C)C(C)O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)CO)O)O)O)CC4=CC=C(C=C4)O)C)O)O[C@H]5[C@H]([C@@H]([C@@H](CO5)O)O[C@@H]6[C@H]([C@@H]([C@H]([C@@H](O6)CO)O)O)NC(=O)C)O |
InChI | InChI=1S/C79H121N11O33/c1-9-11-12-13-14-15-16-17-18-19-50(120-78-66(107)67(49(98)35-117-78)123-77-58(82-40(7)95)63(104)60(101)51(33-91)121-77)62(103)75(115)88-56(37(4)94)72(112)89-57-38(5)118-76(116)48(31-42-22-26-44(97)27-23-42)86-74(114)59(39(6)119-79-65(106)64(105)61(102)52(34-92)122-79)90(8)54(100)32-81-68(108)46(28-29-53(80)99)84-69(109)45(10-2)83-70(110)47(30-41-20-24-43(96)25-21-41)85-71(111)55(36(3)93)87-73(57)113/h10,20-27,36-39,46-52,55-67,77-79,91-94,96-98,101-107H,9,11-19,28-35H2,1-8H3,(H2,80,99)(H,81,108)(H,82,95)(H,83,110)(H,84,109)(H,85,111)(H,86,114)(H,87,113)(H,88,115)(H,89,112)/b45-10-/t36-,37?,38+,39?,46+,47+,48-,49+,50?,51-,52-,55-,56?,57-,58-,59?,60-,61-,62?,63-,64+,65+,66-,67+,77+,78-,79+/m0/s1 |
InChI Key | KGEGUUFEUVXAID-QTPIYKRHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C79H121N11O33 |
Molecular Weight | 1752.90 g/mol |
Exact Mass | 1751.8128253 g/mol |
Topological Polar Surface Area (TPSA) | 690.00 Ų |
XlogP | -1.90 |
Atomic LogP (AlogP) | -7.99 |
H-Bond Acceptor | 33 |
H-Bond Donor | 24 |
Rotatable Bonds | 34 |
DTXSID101335667 |
![2D Structure of [C141, Man]Hassallidin D 2D Structure of [C141, Man]Hassallidin D](https://plantaedb.com/storage/docs/compounds/2023/11/c141-manhassallidin-d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.7669 | 76.69% |
Caco-2 | - | 0.8582 | 85.82% |
Blood Brain Barrier | - | 0.9500 | 95.00% |
Human oral bioavailability | - | 0.7714 | 77.14% |
Subcellular localzation | Mitochondria | 0.4243 | 42.43% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.7909 | 79.09% |
OATP1B3 inhibitior | + | 0.9185 | 91.85% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.9250 | 92.50% |
BSEP inhibitior | + | 0.9664 | 96.64% |
P-glycoprotein inhibitior | + | 0.7417 | 74.17% |
P-glycoprotein substrate | + | 0.8775 | 87.75% |
CYP3A4 substrate | + | 0.7615 | 76.15% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8681 | 86.81% |
CYP3A4 inhibition | + | 0.5066 | 50.66% |
CYP2C9 inhibition | - | 0.8211 | 82.11% |
CYP2C19 inhibition | - | 0.9061 | 90.61% |
CYP2D6 inhibition | - | 0.8200 | 82.00% |
CYP1A2 inhibition | - | 0.8897 | 88.97% |
CYP2C8 inhibition | + | 0.8460 | 84.60% |
CYP inhibitory promiscuity | - | 0.9493 | 94.93% |
UGT catelyzed | - | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9000 | 90.00% |
Carcinogenicity (trinary) | Non-required | 0.5685 | 56.85% |
Eye corrosion | - | 0.9860 | 98.60% |
Eye irritation | - | 0.8953 | 89.53% |
Skin irritation | - | 0.7624 | 76.24% |
Skin corrosion | - | 0.9289 | 92.89% |
Ames mutagenesis | - | 0.6456 | 64.56% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7359 | 73.59% |
Micronuclear | + | 0.8900 | 89.00% |
Hepatotoxicity | - | 0.7086 | 70.86% |
skin sensitisation | - | 0.8756 | 87.56% |
Respiratory toxicity | + | 0.7111 | 71.11% |
Reproductive toxicity | + | 0.9111 | 91.11% |
Mitochondrial toxicity | + | 0.8875 | 88.75% |
Nephrotoxicity | - | 0.7504 | 75.04% |
Acute Oral Toxicity (c) | III | 0.6485 | 64.85% |
Estrogen receptor binding | - | 0.5000 | 50.00% |
Androgen receptor binding | + | 0.7544 | 75.44% |
Thyroid receptor binding | + | 0.7921 | 79.21% |
Glucocorticoid receptor binding | + | 0.8378 | 83.78% |
Aromatase binding | + | 0.7986 | 79.86% |
PPAR gamma | + | 0.7843 | 78.43% |
Honey bee toxicity | - | 0.6062 | 60.62% |
Biodegradation | - | 0.7750 | 77.50% |
Crustacea aquatic toxicity | + | 0.5502 | 55.02% |
Fish aquatic toxicity | + | 0.8934 | 89.34% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.92% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 99.84% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.72% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.62% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.47% | 94.45% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.20% | 93.10% |
CHEMBL3837 | P07711 | Cathepsin L | 97.64% | 96.61% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 97.34% | 90.08% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.85% | 99.17% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 96.04% | 98.59% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 95.84% | 95.64% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.30% | 89.00% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 94.66% | 94.66% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 94.48% | 89.67% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.48% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.33% | 95.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.17% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.96% | 97.25% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 93.96% | 92.86% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.39% | 93.56% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 92.71% | 91.03% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 91.93% | 100.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.40% | 96.90% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.21% | 95.56% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 90.94% | 91.38% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 90.94% | 95.83% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.94% | 97.09% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.86% | 97.64% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.26% | 97.79% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.84% | 93.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.54% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.40% | 90.71% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 88.38% | 85.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.33% | 97.14% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 88.13% | 82.38% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 87.41% | 95.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 87.18% | 95.17% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.09% | 91.24% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.71% | 95.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.70% | 100.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.59% | 97.29% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.19% | 94.75% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.12% | 94.33% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.54% | 86.33% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.94% | 92.88% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.29% | 92.08% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.12% | 89.50% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.96% | 95.50% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.91% | 98.05% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 83.83% | 97.50% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.76% | 92.68% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.47% | 88.56% |
CHEMBL299 | P17252 | Protein kinase C alpha | 82.81% | 98.03% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.66% | 91.81% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.58% | 94.73% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 80.54% | 88.42% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.19% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mikania congesta |
PubChem | 155802156 |
LOTUS | LTS0021728 |
wikiData | Q105272539 |