[(2R,3S,4S,5R,6S)-6-[2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | e8e2bdbf-5cc4-4921-883c-1dd029df5fdf |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid 3-O-p-coumaroyl glycosides |
IUPAC Name | [(2R,3S,4S,5R,6S)-6-[2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)COC(=O)C=CC5=CC=C(C=C5)O)O)O)O)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)/C=C/C5=CC=C(C=C5)O)O)O)O)OC |
InChI | InChI=1S/C32H30O14/c1-41-20-9-6-16(11-21(20)42-2)30-31(27(38)25-19(35)12-18(34)13-22(25)44-30)46-32-29(40)28(39)26(37)23(45-32)14-43-24(36)10-5-15-3-7-17(33)8-4-15/h3-13,23,26,28-29,32-35,37,39-40H,14H2,1-2H3/b10-5+/t23-,26-,28+,29-,32+/m1/s1 |
InChI Key | NIGHTWHFGRAECY-VOLQWMFUSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C32H30O14 |
Molecular Weight | 638.60 g/mol |
Exact Mass | 638.16355563 g/mol |
Topological Polar Surface Area (TPSA) | 211.00 Ų |
XlogP | 2.80 |
BDBM50046959 |
![2D Structure of [(2R,3S,4S,5R,6S)-6-[2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate 2D Structure of [(2R,3S,4S,5R,6S)-6-[2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/c112e2b0-85fd-11ee-98ab-3112b3a0a9a1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 98.46% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.33% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.59% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.71% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 94.58% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.40% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.20% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 93.71% | 98.95% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 92.66% | 95.64% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.47% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.98% | 85.14% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 87.62% | 95.78% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.96% | 94.00% |
CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 86.51% | 98.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.98% | 94.73% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 85.69% | 97.03% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.46% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.90% | 94.45% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.48% | 89.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.41% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.29% | 90.71% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.41% | 92.94% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.79% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.64% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.51% | 86.92% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.45% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scoparia dulcis |
PubChem | 118707633 |
LOTUS | LTS0102283 |
wikiData | Q105179798 |