methyl (2S)-1-[(2S)-2-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-2-[[(5S)-5-methoxydec-9-ynoyl]-methylamino]-3-methylpentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methylbutanoyl]oxy-3-methylbutanoyl]pyrrolidine-2-carboxylate
| Internal ID | e08e4dd0-3a12-44cd-a959-76423fb7dbf3 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides |
| IUPAC Name | methyl (2S)-1-[(2S)-2-[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3S)-2-[[(5S)-5-methoxydec-9-ynoyl]-methylamino]-3-methylpentanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methylbutanoyl]oxy-3-methylbutanoyl]pyrrolidine-2-carboxylate |
| SMILES (Canonical) | CCC(C)C(C(=O)NC(C(C)C)C(=O)NC(C(C)C)C(=O)N(C)C(C(C)C)C(=O)OC(C(C)C)C(=O)N1CCCC1C(=O)OC)N(C)C(=O)CCCC(CCCC#C)OC |
| SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)OC)N(C)C(=O)CCC[C@H](CCCC#C)OC |
| InChI | InChI=1S/C45H77N5O10/c1-16-18-19-22-32(58-14)23-20-25-34(51)48(12)38(31(11)17-2)41(53)46-35(27(3)4)40(52)47-36(28(5)6)42(54)49(13)37(29(7)8)45(57)60-39(30(9)10)43(55)50-26-21-24-33(50)44(56)59-15/h1,27-33,35-39H,17-26H2,2-15H3,(H,46,53)(H,47,52)/t31-,32-,33-,35-,36-,37-,38-,39-/m0/s1 |
| InChI Key | NMOVUNPLGLJIRX-RFGOZZTJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C45H77N5O10 |
| Molecular Weight | 848.10 g/mol |
| Exact Mass | 847.56704367 g/mol |
| Topological Polar Surface Area (TPSA) | 181.00 Ų |
| XlogP | 6.90 |
| Atomic LogP (AlogP) | 4.34 |
| H-Bond Acceptor | 10 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 25 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5766 | 57.66% |
| Caco-2 | - | 0.8541 | 85.41% |
| Blood Brain Barrier | - | 0.5750 | 57.50% |
| Human oral bioavailability | + | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.6353 | 63.53% |
| OATP2B1 inhibitior | - | 0.8586 | 85.86% |
| OATP1B1 inhibitior | + | 0.8458 | 84.58% |
| OATP1B3 inhibitior | + | 0.9256 | 92.56% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.7926 | 79.26% |
| P-glycoprotein inhibitior | + | 0.7505 | 75.05% |
| P-glycoprotein substrate | + | 0.8015 | 80.15% |
| CYP3A4 substrate | + | 0.7305 | 73.05% |
| CYP2C9 substrate | - | 0.6150 | 61.50% |
| CYP2D6 substrate | - | 0.8599 | 85.99% |
| CYP3A4 inhibition | - | 0.5771 | 57.71% |
| CYP2C9 inhibition | - | 0.7472 | 74.72% |
| CYP2C19 inhibition | - | 0.6179 | 61.79% |
| CYP2D6 inhibition | - | 0.9024 | 90.24% |
| CYP1A2 inhibition | - | 0.8542 | 85.42% |
| CYP2C8 inhibition | + | 0.5317 | 53.17% |
| CYP inhibitory promiscuity | - | 0.8339 | 83.39% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8300 | 83.00% |
| Carcinogenicity (trinary) | Non-required | 0.6542 | 65.42% |
| Eye corrosion | - | 0.9844 | 98.44% |
| Eye irritation | - | 0.9041 | 90.41% |
| Skin irritation | - | 0.8135 | 81.35% |
| Skin corrosion | - | 0.9257 | 92.57% |
| Ames mutagenesis | - | 0.5700 | 57.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3935 | 39.35% |
| Micronuclear | + | 0.5900 | 59.00% |
| Hepatotoxicity | + | 0.5937 | 59.37% |
| skin sensitisation | - | 0.8935 | 89.35% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.6778 | 67.78% |
| Mitochondrial toxicity | + | 0.6125 | 61.25% |
| Nephrotoxicity | + | 0.7302 | 73.02% |
| Acute Oral Toxicity (c) | III | 0.6621 | 66.21% |
| Estrogen receptor binding | + | 0.8152 | 81.52% |
| Androgen receptor binding | + | 0.6592 | 65.92% |
| Thyroid receptor binding | + | 0.5249 | 52.49% |
| Glucocorticoid receptor binding | + | 0.6960 | 69.60% |
| Aromatase binding | + | 0.6480 | 64.80% |
| PPAR gamma | + | 0.7475 | 74.75% |
| Honey bee toxicity | - | 0.7079 | 70.79% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.5000 | 50.00% |
| Fish aquatic toxicity | + | 0.8747 | 87.47% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.41% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.69% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.35% | 96.09% |
| CHEMBL4072 | P07858 | Cathepsin B | 97.45% | 93.67% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.35% | 98.33% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 96.80% | 92.12% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.19% | 95.17% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 95.30% | 94.66% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 94.96% | 97.47% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 94.11% | 98.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.02% | 90.17% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 93.89% | 94.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 93.80% | 94.33% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.74% | 100.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 92.72% | 96.38% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.57% | 96.47% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.14% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.86% | 93.56% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 91.79% | 97.86% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 91.76% | 98.10% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.74% | 91.19% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 91.67% | 95.36% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.53% | 100.00% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 91.37% | 97.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.32% | 99.17% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 90.58% | 98.24% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 89.91% | 97.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 89.36% | 93.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.12% | 96.77% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 88.93% | 98.77% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.73% | 90.71% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 88.57% | 99.18% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 87.67% | 97.56% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 87.20% | 96.25% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.16% | 95.89% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.63% | 92.86% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.51% | 95.71% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 86.20% | 95.00% |
| CHEMBL3691 | Q13822 | Autotaxin | 85.98% | 96.39% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.96% | 96.00% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 85.92% | 94.05% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.39% | 92.50% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 85.30% | 94.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.27% | 100.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.03% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.90% | 95.50% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 84.75% | 93.03% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.20% | 90.08% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.66% | 90.24% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.86% | 82.38% |
| CHEMBL3776 | Q14790 | Caspase-8 | 82.83% | 97.06% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.68% | 97.14% |
| CHEMBL204 | P00734 | Thrombin | 82.66% | 96.01% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.15% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.75% | 95.89% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 81.71% | 99.17% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 81.58% | 96.31% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.56% | 93.10% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 81.41% | 89.92% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.28% | 96.90% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.86% | 94.45% |
| CHEMBL5028 | O14672 | ADAM10 | 80.56% | 97.50% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 80.56% | 95.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162843080 |
| LOTUS | LTS0225184 |
| wikiData | Q105181897 |