[3,7-dihydroxy-1,1,4a-trimethyl-6-methylidene-5-[(3-methyl-5-oxooxolan-2-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 2-methylbutanoate
Internal ID | b4db9dd8-57aa-4518-9f5b-b9b67ac0e2df |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | [3,7-dihydroxy-1,1,4a-trimethyl-6-methylidene-5-[(3-methyl-5-oxooxolan-2-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)OC1C(CC2(C(C1(C)C)CC(C(=C)C2CC3C(CC(=O)O3)C)O)C)O |
SMILES (Isomeric) | CCC(C)C(=O)OC1C(CC2(C(C1(C)C)CC(C(=C)C2CC3C(CC(=O)O3)C)O)C)O |
InChI | InChI=1S/C25H40O6/c1-8-13(2)23(29)31-22-18(27)12-25(7)16(10-19-14(3)9-21(28)30-19)15(4)17(26)11-20(25)24(22,5)6/h13-14,16-20,22,26-27H,4,8-12H2,1-3,5-7H3 |
InChI Key | DVDRXXVCKATKHK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H40O6 |
Molecular Weight | 436.60 g/mol |
Exact Mass | 436.28248899 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 3.80 |
There are no found synonyms. |
![2D Structure of [3,7-dihydroxy-1,1,4a-trimethyl-6-methylidene-5-[(3-methyl-5-oxooxolan-2-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 2-methylbutanoate 2D Structure of [3,7-dihydroxy-1,1,4a-trimethyl-6-methylidene-5-[(3-methyl-5-oxooxolan-2-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-yl] 2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/c0f57e60-824b-11ee-b537-a5cd7c8471ff.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.90% | 97.25% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 96.95% | 97.79% |
CHEMBL2581 | P07339 | Cathepsin D | 96.75% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.15% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.75% | 96.09% |
CHEMBL299 | P17252 | Protein kinase C alpha | 94.20% | 98.03% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.18% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.94% | 90.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.92% | 94.45% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.00% | 82.69% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.95% | 96.47% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.49% | 91.19% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.35% | 95.56% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.87% | 93.56% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.82% | 96.61% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.09% | 95.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.21% | 86.33% |
CHEMBL202 | P00374 | Dihydrofolate reductase | 82.50% | 89.92% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.46% | 89.50% |
CHEMBL236 | P41143 | Delta opioid receptor | 82.08% | 99.35% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.59% | 96.38% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.18% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.00% | 96.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.83% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.80% | 91.49% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.75% | 94.33% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.55% | 94.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.08% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Urolepis hecatantha |
PubChem | 162920061 |
LOTUS | LTS0081374 |
wikiData | Q104989925 |