[(1R,2S,5S,6R,10R,11S,12R,15R,19S)-6-(furan-3-yl)-1,5,10,15-tetramethyl-18-oxo-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-8,16-dien-11-yl] benzoate
| Internal ID | bdd94674-9d5e-442f-84cc-3d29d823222b |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
| IUPAC Name | [(1R,2S,5S,6R,10R,11S,12R,15R,19S)-6-(furan-3-yl)-1,5,10,15-tetramethyl-18-oxo-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-8,16-dien-11-yl] benzoate |
| SMILES (Canonical) | CC12CCC3C4(C5C(C(C3(C1=CCC2C6=COC=C6)C)OC(=O)C7=CC=CC=C7)OCC5(C=CC4=O)C)C |
| SMILES (Isomeric) | C[C@@]12CC[C@@H]3[C@@]4([C@H]5[C@H]([C@H]([C@]3(C1=CC[C@H]2C6=COC=C6)C)OC(=O)C7=CC=CC=C7)OC[C@@]5(C=CC4=O)C)C |
| InChI | InChI=1S/C33H36O5/c1-30-15-13-25(34)33(4)24-12-16-31(2)22(21-14-17-36-18-21)10-11-23(31)32(24,3)28(26(27(30)33)37-19-30)38-29(35)20-8-6-5-7-9-20/h5-9,11,13-15,17-18,22,24,26-28H,10,12,16,19H2,1-4H3/t22-,24-,26+,27-,28+,30-,31-,32-,33-/m0/s1 |
| InChI Key | OINZOSRLDSTGHZ-JRDOKHADSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C33H36O5 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.25627424 g/mol |
| Topological Polar Surface Area (TPSA) | 65.70 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.53% | 90.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.68% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.96% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.24% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.62% | 98.95% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 92.51% | 83.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.37% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.76% | 95.56% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 90.10% | 87.67% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.20% | 82.69% |
| CHEMBL5028 | O14672 | ADAM10 | 87.35% | 97.50% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.76% | 81.11% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.85% | 91.07% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.53% | 91.19% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.23% | 94.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.11% | 96.09% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 83.05% | 94.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.04% | 97.14% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.76% | 93.00% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.20% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Chisocheton ceramicus |
| PubChem | 71567281 |
| LOTUS | LTS0136024 |
| wikiData | Q105192630 |