5-[(2S,3R,4R,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dimethoxyphenyl)-3,6,7-trimethoxychromen-4-one
Internal ID | 258f42f6-392b-478a-a2fd-6e51008f11b9 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 5-[(2S,3R,4R,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dimethoxyphenyl)-3,6,7-trimethoxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=C3C(=CC(=C2OC)OC)OC(=C(C3=O)OC)C4=CC(=C(C=C4)OC)OC)O)O)OC5C(C(C(C(O5)CO)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC2=C3C(=CC(=C2OC)OC)OC(=C(C3=O)OC)C4=CC(=C(C=C4)OC)OC)O)O)O[C@H]5[C@@H]([C@H]([C@H]([C@H](O5)CO)O)O)O |
InChI | InChI=1S/C32H40O17/c1-12-26(48-32-24(38)22(36)20(34)18(11-33)47-32)23(37)25(39)31(45-12)49-29-19-16(10-17(42-4)28(29)43-5)46-27(30(44-6)21(19)35)13-7-8-14(40-2)15(9-13)41-3/h7-10,12,18,20,22-26,31-34,36-39H,11H2,1-6H3/t12-,18+,20-,22-,23+,24+,25+,26-,31-,32-/m0/s1 |
InChI Key | PAJMMZMRJVANIH-KFCAROKSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H40O17 |
Molecular Weight | 696.60 g/mol |
Exact Mass | 696.22654980 g/mol |
Topological Polar Surface Area (TPSA) | 231.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of 5-[(2S,3R,4R,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dimethoxyphenyl)-3,6,7-trimethoxychromen-4-one 2D Structure of 5-[(2S,3R,4R,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dimethoxyphenyl)-3,6,7-trimethoxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/c0a577f0-8745-11ee-822f-1391ef5ce43b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.38% | 94.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.10% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.95% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.59% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.47% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.37% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.03% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.73% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.73% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.88% | 86.92% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 88.14% | 92.98% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.44% | 96.21% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 82.70% | 90.20% |
CHEMBL220 | P22303 | Acetylcholinesterase | 82.15% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.78% | 95.56% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.63% | 95.83% |
CHEMBL5747 | Q92793 | CREB-binding protein | 81.14% | 95.12% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vitex negundo |
PubChem | 162892086 |
LOTUS | LTS0084202 |
wikiData | Q105204557 |