Bryodulcosigenin
Internal ID | e9c7c1c1-c42d-4f2d-89e5-2722f5d96b4c |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cucurbitacins |
IUPAC Name | (3S,8S,9R,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-3-hydroxy-4,4,9,13,14-pentamethyl-1,2,3,7,8,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-11-one |
SMILES (Canonical) | CC(CCC(C(C)(C)O)O)C1CCC2(C1(CC(=O)C3(C2CC=C4C3CCC(C4(C)C)O)C)C)C |
SMILES (Isomeric) | C[C@H](CC[C@H](C(C)(C)O)O)[C@H]1CC[C@@]2([C@@]1(CC(=O)[C@@]3([C@H]2CC=C4[C@H]3CC[C@@H](C4(C)C)O)C)C)C |
InChI | InChI=1S/C30H50O4/c1-18(9-13-24(32)27(4,5)34)19-15-16-28(6)22-12-10-20-21(11-14-23(31)26(20,2)3)30(22,8)25(33)17-29(19,28)7/h10,18-19,21-24,31-32,34H,9,11-17H2,1-8H3/t18-,19-,21-,22+,23+,24-,28+,29-,30+/m1/s1 |
InChI Key | FPMQKXQOBKDVHF-DJHQPCGUSA-N |
Popularity | 2 references in papers |
Molecular Formula | C30H50O4 |
Molecular Weight | 474.70 g/mol |
Exact Mass | 474.37091007 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 5.10 |
11-Oxomogrol |
CHEMBL465204 |
NSC710352 |
AKOS037515010 |
NSC-710352 |
NCI60_038830 |
(24R)-11-Oxocucurbit-5-ene-3.beta.,25-triol |
(3ss,9ss,10a,24R)-3,24,25-Trihydroxy-9-methyl-19-norlanost-5-en-11-one |
88930-16-9 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.44% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.88% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.66% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.28% | 91.11% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 91.23% | 97.79% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.73% | 94.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.14% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.12% | 93.56% |
CHEMBL1907 | P15144 | Aminopeptidase N | 86.87% | 93.31% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.71% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.69% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.45% | 90.71% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.07% | 100.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.67% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.49% | 86.33% |
CHEMBL299 | P17252 | Protein kinase C alpha | 82.38% | 98.03% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.14% | 82.69% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 81.89% | 94.78% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.87% | 93.03% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.73% | 93.04% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.62% | 97.29% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.51% | 96.43% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.01% | 96.61% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 80.66% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Siraitia grosvenorii |
PubChem | 399493 |
LOTUS | LTS0237891 |
wikiData | Q104999277 |